About 2-(2,3-difluorophenyl)-6-hydroxy-6-methyl-2-(methylamino)cyclohexan-1-one;hydrochloride
2-(2,3-difluorophenyl)-6-hydroxy-6-methyl-2-(methylamino)cyclohexan-1-one;hydrochloride (PubChem CID 169100300) has the molecular formula C14H18ClF2NO2
and a molecular weight of 305.75 g/mol. Its IUPAC name is 2-(2,3-difluorophenyl)-6-hydroxy-6-methyl-2-(methylamino)cyclohexan-1-one;hydrochloride.
Molecular Properties
| Compound Name | 2-(2,3-difluorophenyl)-6-hydroxy-6-methyl-2-(methylamino)cyclohexan-1-one;hydrochloride |
| PubChem CID | 169100300 |
| Molecular Formula | C14H18ClF2NO2 |
| Molecular Weight | 305.75 g/mol |
| Exact Mass | 305.10 |
| IUPAC Name | 2-(2,3-difluorophenyl)-6-hydroxy-6-methyl-2-(methylamino)cyclohexan-1-one;hydrochloride |
| SMILES | CNC1(c2cccc(F)c2F)CCCC(C)(O)C1=O.Cl |
| InChI | InChI=1S/C14H17F2NO2.ClH/c1-13(19)7-4-8-14(17-2,12(13)18)9-5-3-6-10(15)11(9)16;/h3,5-6,17,19H,4,7-8H2,1-2H3;1H |
| InChIKey | FZDIZESVYWTUIG-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 305.75 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(2,3-difluorophenyl)-6-hydroxy-6-methyl-2-(methylamino)cyclohexan-1-one;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,3-difluorophenyl)-6-hydroxy-6-methyl-2-(methylamino)cyclohexan-1-one;hydrochloride?
The IUPAC name of 2-(2,3-difluorophenyl)-6-hydroxy-6-methyl-2-(methylamino)cyclohexan-1-one;hydrochloride (CID 169100300) is 2-(2,3-difluorophenyl)-6-hydroxy-6-methyl-2-(methylamino)cyclohexan-1-one;hydrochloride.
What is the SMILES notation for 2-(2,3-difluorophenyl)-6-hydroxy-6-methyl-2-(methylamino)cyclohexan-1-one;hydrochloride?
The canonical SMILES for 2-(2,3-difluorophenyl)-6-hydroxy-6-methyl-2-(methylamino)cyclohexan-1-one;hydrochloride is CNC1(c2cccc(F)c2F)CCCC(C)(O)C1=O.Cl.
What is the InChIKey of 2-(2,3-difluorophenyl)-6-hydroxy-6-methyl-2-(methylamino)cyclohexan-1-one;hydrochloride?
The InChIKey is FZDIZESVYWTUIG-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17F2NO2.ClH/c1-13(19)7-4-8-14(17-2,12(13)18)9-5-3-6-10(15)11(9)16;/h3,5-6,17,19H,4,7-8H2,1-2H3;1H.
What are the key properties of 2-(2,3-difluorophenyl)-6-hydroxy-6-methyl-2-(methylamino)cyclohexan-1-one;hydrochloride?
2-(2,3-difluorophenyl)-6-hydroxy-6-methyl-2-(methylamino)cyclohexan-1-one;hydrochloride has a molecular weight of 305.75 g/mol, XLogP of 2.31, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,3-difluorophenyl)-6-hydroxy-6-methyl-2-(methylamino)cyclohexan-1-one;hydrochloride is sourced from PubChem (CID 169100300), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).