C21H21FN4O2 — CID 169100863
1-[8-[(4-fluorophenyl)methyl]spiro[1,5,10,12-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraene-3,4'-oxane]-5-yl]ethanone (PubChem CID 169100863) has the molecular formula C21H21FN4O2 and a molecular weight of 380.42 g/mol. Its IUPAC name is 1-[8-[(4-fluorophenyl)methyl]spiro[1,5,10,12-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraene-3,4'-oxane]-5-yl]ethanone.
| Compound Name | 1-[8-[(4-fluorophenyl)methyl]spiro[1,5,10,12-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraene-3,4'-oxane]-5-yl]ethanone |
|---|---|
| PubChem CID | 169100863 |
| Molecular Formula | C21H21FN4O2 |
| Molecular Weight | 380.42 g/mol |
| Exact Mass | 380.16 |
| IUPAC Name | 1-[8-[(4-fluorophenyl)methyl]spiro[1,5,10,12-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraene-3,4'-oxane]-5-yl]ethanone |
| SMILES | CC(=O)N1CC2(CCOCC2)c2c1cc(Cc1ccc(F)cc1)c1ncnn21 |
| InChI | InChI=1S/C21H21FN4O2/c1-14(27)25-12-21(6-8-28-9-7-21)19-18(25)11-16(20-23-13-24-26(19)20)10-15-2-4-17(22)5-3-15/h2-5,11,13H,6-10,12H2,1H3 |
| InChIKey | GOHBAHDGNOTYJR-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 59.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.42 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |