C10H16N2O4 — CID 169100947
2,2,3a,6a-tetramethyl-4-oxo-5,6-dihydro-[1,3]dioxolo[4,5-c]pyrrole-6-carboxamide (PubChem CID 169100947) has the molecular formula C10H16N2O4 and a molecular weight of 228.25 g/mol. Its IUPAC name is 2,2,3a,6a-tetramethyl-4-oxo-5,6-dihydro-[1,3]dioxolo[4,5-c]pyrrole-6-carboxamide.
| Compound Name | 2,2,3a,6a-tetramethyl-4-oxo-5,6-dihydro-[1,3]dioxolo[4,5-c]pyrrole-6-carboxamide |
|---|---|
| PubChem CID | 169100947 |
| Molecular Formula | C10H16N2O4 |
| Molecular Weight | 228.25 g/mol |
| Exact Mass | 228.11 |
| IUPAC Name | 2,2,3a,6a-tetramethyl-4-oxo-5,6-dihydro-[1,3]dioxolo[4,5-c]pyrrole-6-carboxamide |
| SMILES | CC1(C)OC2(C)C(=O)NC(C(N)=O)C2(C)O1 |
| InChI | InChI=1S/C10H16N2O4/c1-8(2)15-9(3)5(6(11)13)12-7(14)10(9,4)16-8/h5H,1-4H3,(H2,11,13)(H,12,14) |
| InChIKey | FGWGWZZPZPWUBQ-UHFFFAOYSA-N |
| XLogP | -0.73 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.25 |
| LogP ≤ 5 | -0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |