About butyl 4-methyl-4-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethoxy]cyclohexa-1,5-diene-1-carboxylate
butyl 4-methyl-4-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethoxy]cyclohexa-1,5-diene-1-carboxylate (PubChem CID 169101128) has the molecular formula C18H28O5
and a molecular weight of 324.42 g/mol. Its IUPAC name is butyl 4-methyl-4-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethoxy]cyclohexa-1,5-diene-1-carboxylate.
Molecular Properties
| Compound Name | butyl 4-methyl-4-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethoxy]cyclohexa-1,5-diene-1-carboxylate |
| PubChem CID | 169101128 |
| Molecular Formula | C18H28O5 |
| Molecular Weight | 324.42 g/mol |
| Exact Mass | 324.19 |
| IUPAC Name | butyl 4-methyl-4-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethoxy]cyclohexa-1,5-diene-1-carboxylate |
| SMILES | CCCCOC(=O)C1=CCC(C)(OCC(=O)OC(C)(C)C)C=C1 |
| InChI | InChI=1S/C18H28O5/c1-6-7-12-21-16(20)14-8-10-18(5,11-9-14)22-13-15(19)23-17(2,3)4/h8-10H,6-7,11-13H2,1-5H3 |
| InChIKey | SWOOBTJTGDXDNI-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.42 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze butyl 4-methyl-4-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethoxy]cyclohexa-1,5-diene-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butyl 4-methyl-4-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethoxy]cyclohexa-1,5-diene-1-carboxylate?
The IUPAC name of butyl 4-methyl-4-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethoxy]cyclohexa-1,5-diene-1-carboxylate (CID 169101128) is butyl 4-methyl-4-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethoxy]cyclohexa-1,5-diene-1-carboxylate.
What is the SMILES notation for butyl 4-methyl-4-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethoxy]cyclohexa-1,5-diene-1-carboxylate?
The canonical SMILES for butyl 4-methyl-4-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethoxy]cyclohexa-1,5-diene-1-carboxylate is CCCCOC(=O)C1=CCC(C)(OCC(=O)OC(C)(C)C)C=C1.
What is the InChIKey of butyl 4-methyl-4-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethoxy]cyclohexa-1,5-diene-1-carboxylate?
The InChIKey is SWOOBTJTGDXDNI-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H28O5/c1-6-7-12-21-16(20)14-8-10-18(5,11-9-14)22-13-15(19)23-17(2,3)4/h8-10H,6-7,11-13H2,1-5H3.
What are the key properties of butyl 4-methyl-4-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethoxy]cyclohexa-1,5-diene-1-carboxylate?
butyl 4-methyl-4-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethoxy]cyclohexa-1,5-diene-1-carboxylate has a molecular weight of 324.42 g/mol, XLogP of 3.33, 7 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for butyl 4-methyl-4-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethoxy]cyclohexa-1,5-diene-1-carboxylate is sourced from PubChem (CID 169101128), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).