C19H20N4O2 — CID 169101444
4-[(2-hydroxyethylamino)methyl]-2-(3-phenylanilino)-1H-pyrimidin-6-one (PubChem CID 169101444) has the molecular formula C19H20N4O2 and a molecular weight of 336.40 g/mol. Its IUPAC name is 4-[(2-hydroxyethylamino)methyl]-2-(3-phenylanilino)-1H-pyrimidin-6-one.
| Compound Name | 4-[(2-hydroxyethylamino)methyl]-2-(3-phenylanilino)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 169101444 |
| Molecular Formula | C19H20N4O2 |
| Molecular Weight | 336.40 g/mol |
| Exact Mass | 336.16 |
| IUPAC Name | 4-[(2-hydroxyethylamino)methyl]-2-(3-phenylanilino)-1H-pyrimidin-6-one |
| SMILES | O=c1cc(CNCCO)nc(Nc2cccc(-c3ccccc3)c2)[nH]1 |
| InChI | InChI=1S/C19H20N4O2/c24-10-9-20-13-17-12-18(25)23-19(22-17)21-16-8-4-7-15(11-16)14-5-2-1-3-6-14/h1-8,11-12,20,24H,9-10,13H2,(H2,21,22,23,25) |
| InChIKey | RHMSLJUYTZJPHJ-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 90.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.40 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|