C54H58N4O6 — CID 169102960
5,5-bis[4-[4-[bis(oxiran-2-ylmethyl)amino]phenoxy]phenyl]-2,2-diphenylhexane-3,3-diamine (PubChem CID 169102960) has the molecular formula C54H58N4O6 and a molecular weight of 859.08 g/mol. Its IUPAC name is 5,5-bis[4-[4-[bis(oxiran-2-ylmethyl)amino]phenoxy]phenyl]-2,2-diphenylhexane-3,3-diamine.
| Compound Name | 5,5-bis[4-[4-[bis(oxiran-2-ylmethyl)amino]phenoxy]phenyl]-2,2-diphenylhexane-3,3-diamine |
|---|---|
| PubChem CID | 169102960 |
| Molecular Formula | C54H58N4O6 |
| Molecular Weight | 859.08 g/mol |
| Exact Mass | 858.44 |
| IUPAC Name | 5,5-bis[4-[4-[bis(oxiran-2-ylmethyl)amino]phenoxy]phenyl]-2,2-diphenylhexane-3,3-diamine |
| SMILES | CC(CC(N)(N)C(C)(c1ccccc1)c1ccccc1)(c1ccc(Oc2ccc(N(CC3CO3)CC3CO3)cc2)cc1)c1ccc(Oc2ccc(N(CC3CO3)CC3CO3)cc2)cc1 |
| InChI | InChI=1S/C54H58N4O6/c1-52(37-54(55,56)53(2,40-9-5-3-6-10-40)41-11-7-4-8-12-41,38-13-21-44(22-14-38)63-46-25-17-42(18-26-46)57(29-48-33-59-48)30-49-34-60-49)39-15-23-45(24-16-39)64-47-27-19-43(20-28-47)58(31-50-35-61-50)32-51-36-62-51/h3-28,48-51H,29-37,55-56H2,1-2H3 |
| InChIKey | ZONPGHOIAYMCSO-UHFFFAOYSA-N |
| XLogP | 8.80 |
| TPSA | 127.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 859.08 |
| LogP ≤ 5 | 8.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|