About methyl 6'-methylspiro[azetidine-3,2'-chromene]-7'-carboxylate
methyl 6'-methylspiro[azetidine-3,2'-chromene]-7'-carboxylate (PubChem CID 169103676) has the molecular formula C14H15NO3
and a molecular weight of 245.28 g/mol. Its IUPAC name is methyl 6'-methylspiro[azetidine-3,2'-chromene]-7'-carboxylate.
Molecular Properties
| Compound Name | methyl 6'-methylspiro[azetidine-3,2'-chromene]-7'-carboxylate |
| PubChem CID | 169103676 |
| Molecular Formula | C14H15NO3 |
| Molecular Weight | 245.28 g/mol |
| Exact Mass | 245.11 |
| IUPAC Name | methyl 6'-methylspiro[azetidine-3,2'-chromene]-7'-carboxylate |
| SMILES | COC(=O)c1cc2c(cc1C)C=CC1(CNC1)O2 |
| InChI | InChI=1S/C14H15NO3/c1-9-5-10-3-4-14(7-15-8-14)18-12(10)6-11(9)13(16)17-2/h3-6,15H,7-8H2,1-2H3 |
| InChIKey | CASCIYQEPQGZFJ-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.28 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl 6'-methylspiro[azetidine-3,2'-chromene]-7'-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 6'-methylspiro[azetidine-3,2'-chromene]-7'-carboxylate?
The IUPAC name of methyl 6'-methylspiro[azetidine-3,2'-chromene]-7'-carboxylate (CID 169103676) is methyl 6'-methylspiro[azetidine-3,2'-chromene]-7'-carboxylate.
What is the SMILES notation for methyl 6'-methylspiro[azetidine-3,2'-chromene]-7'-carboxylate?
The canonical SMILES for methyl 6'-methylspiro[azetidine-3,2'-chromene]-7'-carboxylate is COC(=O)c1cc2c(cc1C)C=CC1(CNC1)O2.
What is the InChIKey of methyl 6'-methylspiro[azetidine-3,2'-chromene]-7'-carboxylate?
The InChIKey is CASCIYQEPQGZFJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15NO3/c1-9-5-10-3-4-14(7-15-8-14)18-12(10)6-11(9)13(16)17-2/h3-6,15H,7-8H2,1-2H3.
What are the key properties of methyl 6'-methylspiro[azetidine-3,2'-chromene]-7'-carboxylate?
methyl 6'-methylspiro[azetidine-3,2'-chromene]-7'-carboxylate has a molecular weight of 245.28 g/mol, XLogP of 1.53, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 6'-methylspiro[azetidine-3,2'-chromene]-7'-carboxylate is sourced from PubChem (CID 169103676), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).