About 1-cyclopropyl-3-(4,5-diphenyl-1H-imidazol-2-yl)propan-1-one
1-cyclopropyl-3-(4,5-diphenyl-1H-imidazol-2-yl)propan-1-one (PubChem CID 169104066) has the molecular formula C21H20N2O
and a molecular weight of 316.40 g/mol. Its IUPAC name is 1-cyclopropyl-3-(4,5-diphenyl-1H-imidazol-2-yl)propan-1-one.
Molecular Properties
| Compound Name | 1-cyclopropyl-3-(4,5-diphenyl-1H-imidazol-2-yl)propan-1-one |
| PubChem CID | 169104066 |
| Molecular Formula | C21H20N2O |
| Molecular Weight | 316.40 g/mol |
| Exact Mass | 316.16 |
| IUPAC Name | 1-cyclopropyl-3-(4,5-diphenyl-1H-imidazol-2-yl)propan-1-one |
| SMILES | O=C(CCc1nc(-c2ccccc2)c(-c2ccccc2)[nH]1)C1CC1 |
| InChI | InChI=1S/C21H20N2O/c24-18(15-11-12-15)13-14-19-22-20(16-7-3-1-4-8-16)21(23-19)17-9-5-2-6-10-17/h1-10,15H,11-14H2,(H,22,23) |
| InChIKey | PWDFZCKTUGYXNS-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.40 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-cyclopropyl-3-(4,5-diphenyl-1H-imidazol-2-yl)propan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclopropyl-3-(4,5-diphenyl-1H-imidazol-2-yl)propan-1-one?
The IUPAC name of 1-cyclopropyl-3-(4,5-diphenyl-1H-imidazol-2-yl)propan-1-one (CID 169104066) is 1-cyclopropyl-3-(4,5-diphenyl-1H-imidazol-2-yl)propan-1-one.
What is the SMILES notation for 1-cyclopropyl-3-(4,5-diphenyl-1H-imidazol-2-yl)propan-1-one?
The canonical SMILES for 1-cyclopropyl-3-(4,5-diphenyl-1H-imidazol-2-yl)propan-1-one is O=C(CCc1nc(-c2ccccc2)c(-c2ccccc2)[nH]1)C1CC1.
What is the InChIKey of 1-cyclopropyl-3-(4,5-diphenyl-1H-imidazol-2-yl)propan-1-one?
The InChIKey is PWDFZCKTUGYXNS-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H20N2O/c24-18(15-11-12-15)13-14-19-22-20(16-7-3-1-4-8-16)21(23-19)17-9-5-2-6-10-17/h1-10,15H,11-14H2,(H,22,23).
What are the key properties of 1-cyclopropyl-3-(4,5-diphenyl-1H-imidazol-2-yl)propan-1-one?
1-cyclopropyl-3-(4,5-diphenyl-1H-imidazol-2-yl)propan-1-one has a molecular weight of 316.40 g/mol, XLogP of 4.66, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclopropyl-3-(4,5-diphenyl-1H-imidazol-2-yl)propan-1-one is sourced from PubChem (CID 169104066), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).