About ethane;4-(1,3-oxazol-2-ylsulfanyl)butan-2-one
ethane;4-(1,3-oxazol-2-ylsulfanyl)butan-2-one (PubChem CID 169104086) has the molecular formula C9H15NO2S
and a molecular weight of 201.29 g/mol. Its IUPAC name is ethane;4-(1,3-oxazol-2-ylsulfanyl)butan-2-one.
Molecular Properties
| Compound Name | ethane;4-(1,3-oxazol-2-ylsulfanyl)butan-2-one |
| PubChem CID | 169104086 |
| Molecular Formula | C9H15NO2S |
| Molecular Weight | 201.29 g/mol |
| Exact Mass | 201.08 |
| IUPAC Name | ethane;4-(1,3-oxazol-2-ylsulfanyl)butan-2-one |
| SMILES | CC.CC(=O)CCSc1ncco1 |
| InChI | InChI=1S/C7H9NO2S.C2H6/c1-6(9)2-5-11-7-8-3-4-10-7;1-2/h3-4H,2,5H2,1H3;1-2H3 |
| InChIKey | WKDOLWATUGUGFD-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 43.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.29 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethane;4-(1,3-oxazol-2-ylsulfanyl)butan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;4-(1,3-oxazol-2-ylsulfanyl)butan-2-one?
The IUPAC name of ethane;4-(1,3-oxazol-2-ylsulfanyl)butan-2-one (CID 169104086) is ethane;4-(1,3-oxazol-2-ylsulfanyl)butan-2-one.
What is the SMILES notation for ethane;4-(1,3-oxazol-2-ylsulfanyl)butan-2-one?
The canonical SMILES for ethane;4-(1,3-oxazol-2-ylsulfanyl)butan-2-one is CC.CC(=O)CCSc1ncco1.
What is the InChIKey of ethane;4-(1,3-oxazol-2-ylsulfanyl)butan-2-one?
The InChIKey is WKDOLWATUGUGFD-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9NO2S.C2H6/c1-6(9)2-5-11-7-8-3-4-10-7;1-2/h3-4H,2,5H2,1H3;1-2H3.
What are the key properties of ethane;4-(1,3-oxazol-2-ylsulfanyl)butan-2-one?
ethane;4-(1,3-oxazol-2-ylsulfanyl)butan-2-one has a molecular weight of 201.29 g/mol, XLogP of 2.77, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;4-(1,3-oxazol-2-ylsulfanyl)butan-2-one is sourced from PubChem (CID 169104086), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).