About 1-methylpiperidin-4-amine;N'-methyl-N-prop-2-enylideneethanimidamide
1-methylpiperidin-4-amine;N'-methyl-N-prop-2-enylideneethanimidamide (PubChem CID 169104192) has the molecular formula C12H24N4
and a molecular weight of 224.35 g/mol. Its IUPAC name is 1-methylpiperidin-4-amine;N'-methyl-N-prop-2-enylideneethanimidamide.
Molecular Properties
| Compound Name | 1-methylpiperidin-4-amine;N'-methyl-N-prop-2-enylideneethanimidamide |
| PubChem CID | 169104192 |
| Molecular Formula | C12H24N4 |
| Molecular Weight | 224.35 g/mol |
| Exact Mass | 224.20 |
| IUPAC Name | 1-methylpiperidin-4-amine;N'-methyl-N-prop-2-enylideneethanimidamide |
| SMILES | C=C/C=N/C(C)=N/C.CN1CCC(N)CC1 |
| InChI | InChI=1S/C6H14N2.C6H10N2/c1-8-4-2-6(7)3-5-8;1-4-5-8-6(2)7-3/h6H,2-5,7H2,1H3;4-5H,1H2,2-3H3/b;7-6+,8-5+ |
| InChIKey | UWNYEJMFMSOPNF-LZMDBRPDSA-N |
| XLogP | 1.33 |
| TPSA | 53.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.35 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 1-methylpiperidin-4-amine;N'-methyl-N-prop-2-enylideneethanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methylpiperidin-4-amine;N'-methyl-N-prop-2-enylideneethanimidamide?
The IUPAC name of 1-methylpiperidin-4-amine;N'-methyl-N-prop-2-enylideneethanimidamide (CID 169104192) is 1-methylpiperidin-4-amine;N'-methyl-N-prop-2-enylideneethanimidamide.
What is the SMILES notation for 1-methylpiperidin-4-amine;N'-methyl-N-prop-2-enylideneethanimidamide?
The canonical SMILES for 1-methylpiperidin-4-amine;N'-methyl-N-prop-2-enylideneethanimidamide is C=C/C=N/C(C)=N/C.CN1CCC(N)CC1.
What is the InChIKey of 1-methylpiperidin-4-amine;N'-methyl-N-prop-2-enylideneethanimidamide?
The InChIKey is UWNYEJMFMSOPNF-LZMDBRPDSA-N. The full InChI is InChI=1S/C6H14N2.C6H10N2/c1-8-4-2-6(7)3-5-8;1-4-5-8-6(2)7-3/h6H,2-5,7H2,1H3;4-5H,1H2,2-3H3/b;7-6+,8-5+.
What are the key properties of 1-methylpiperidin-4-amine;N'-methyl-N-prop-2-enylideneethanimidamide?
1-methylpiperidin-4-amine;N'-methyl-N-prop-2-enylideneethanimidamide has a molecular weight of 224.35 g/mol, XLogP of 1.33, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methylpiperidin-4-amine;N'-methyl-N-prop-2-enylideneethanimidamide is sourced from PubChem (CID 169104192), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).