About 6-[[6-(1,1-difluoroethyl)pyridazin-3-yl]methyl]-2-azaspiro[3.3]heptane
6-[[6-(1,1-difluoroethyl)pyridazin-3-yl]methyl]-2-azaspiro[3.3]heptane (PubChem CID 169105363) has the molecular formula C13H17F2N3
and a molecular weight of 253.30 g/mol. Its IUPAC name is 6-[[6-(1,1-difluoroethyl)pyridazin-3-yl]methyl]-2-azaspiro[3.3]heptane.
Molecular Properties
| Compound Name | 6-[[6-(1,1-difluoroethyl)pyridazin-3-yl]methyl]-2-azaspiro[3.3]heptane |
| PubChem CID | 169105363 |
| Molecular Formula | C13H17F2N3 |
| Molecular Weight | 253.30 g/mol |
| Exact Mass | 253.14 |
| IUPAC Name | 6-[[6-(1,1-difluoroethyl)pyridazin-3-yl]methyl]-2-azaspiro[3.3]heptane |
| SMILES | CC(F)(F)c1ccc(CC2CC3(CNC3)C2)nn1 |
| InChI | InChI=1S/C13H17F2N3/c1-12(14,15)11-3-2-10(17-18-11)4-9-5-13(6-9)7-16-8-13/h2-3,9,16H,4-8H2,1H3 |
| InChIKey | VXUFPKOHKPWUFE-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.30 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-[[6-(1,1-difluoroethyl)pyridazin-3-yl]methyl]-2-azaspiro[3.3]heptane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[[6-(1,1-difluoroethyl)pyridazin-3-yl]methyl]-2-azaspiro[3.3]heptane?
The IUPAC name of 6-[[6-(1,1-difluoroethyl)pyridazin-3-yl]methyl]-2-azaspiro[3.3]heptane (CID 169105363) is 6-[[6-(1,1-difluoroethyl)pyridazin-3-yl]methyl]-2-azaspiro[3.3]heptane.
What is the SMILES notation for 6-[[6-(1,1-difluoroethyl)pyridazin-3-yl]methyl]-2-azaspiro[3.3]heptane?
The canonical SMILES for 6-[[6-(1,1-difluoroethyl)pyridazin-3-yl]methyl]-2-azaspiro[3.3]heptane is CC(F)(F)c1ccc(CC2CC3(CNC3)C2)nn1.
What is the InChIKey of 6-[[6-(1,1-difluoroethyl)pyridazin-3-yl]methyl]-2-azaspiro[3.3]heptane?
The InChIKey is VXUFPKOHKPWUFE-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17F2N3/c1-12(14,15)11-3-2-10(17-18-11)4-9-5-13(6-9)7-16-8-13/h2-3,9,16H,4-8H2,1H3.
What are the key properties of 6-[[6-(1,1-difluoroethyl)pyridazin-3-yl]methyl]-2-azaspiro[3.3]heptane?
6-[[6-(1,1-difluoroethyl)pyridazin-3-yl]methyl]-2-azaspiro[3.3]heptane has a molecular weight of 253.30 g/mol, XLogP of 2.13, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[[6-(1,1-difluoroethyl)pyridazin-3-yl]methyl]-2-azaspiro[3.3]heptane is sourced from PubChem (CID 169105363), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).