C22H23ClFN5O2 — CID 169106082
N-[(4R)-1-(2-chloro-6-fluoro-3-methoxyphenyl)-4,5,6,7-tetrahydroindazol-4-yl]-5,6,7,8-tetrahydroimidazo[1,5-a]pyridine-1-carboxamide (PubChem CID 169106082) has the molecular formula C22H23ClFN5O2 and a molecular weight of 443.91 g/mol. Its IUPAC name is N-[(4R)-1-(2-chloro-6-fluoro-3-methoxyphenyl)-4,5,6,7-tetrahydroindazol-4-yl]-5,6,7,8-tetrahydroimidazo[1,5-a]pyridine-1-carboxamide.
| Compound Name | N-[(4R)-1-(2-chloro-6-fluoro-3-methoxyphenyl)-4,5,6,7-tetrahydroindazol-4-yl]-5,6,7,8-tetrahydroimidazo[1,5-a]pyridine-1-carboxamide |
|---|---|
| PubChem CID | 169106082 |
| Molecular Formula | C22H23ClFN5O2 |
| Molecular Weight | 443.91 g/mol |
| Exact Mass | 443.15 |
| IUPAC Name | N-[(4R)-1-(2-chloro-6-fluoro-3-methoxyphenyl)-4,5,6,7-tetrahydroindazol-4-yl]-5,6,7,8-tetrahydroimidazo[1,5-a]pyridine-1-carboxamide |
| SMILES | COc1ccc(F)c(-n2ncc3c2CCC[C@H]3NC(=O)c2ncn3c2CCCC3)c1Cl |
| InChI | InChI=1S/C22H23ClFN5O2/c1-31-18-9-8-14(24)21(19(18)23)29-16-7-4-5-15(13(16)11-26-29)27-22(30)20-17-6-2-3-10-28(17)12-25-20/h8-9,11-12,15H,2-7,10H2,1H3,(H,27,30)/t15-/m1/s1 |
| InChIKey | FYTXRQRKAFGLRE-OAHLLOKOSA-N |
| XLogP | 4.01 |
| TPSA | 73.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.91 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |