About 4-(2-cyano-4,4-difluoropyrrolidin-1-yl)-4-oxobutanoic acid;ethane
4-(2-cyano-4,4-difluoropyrrolidin-1-yl)-4-oxobutanoic acid;ethane (PubChem CID 169106255) has the molecular formula C11H16F2N2O3
and a molecular weight of 262.26 g/mol. Its IUPAC name is 4-(2-cyano-4,4-difluoropyrrolidin-1-yl)-4-oxobutanoic acid;ethane.
Molecular Properties
| Compound Name | 4-(2-cyano-4,4-difluoropyrrolidin-1-yl)-4-oxobutanoic acid;ethane |
| PubChem CID | 169106255 |
| Molecular Formula | C11H16F2N2O3 |
| Molecular Weight | 262.26 g/mol |
| Exact Mass | 262.11 |
| IUPAC Name | 4-(2-cyano-4,4-difluoropyrrolidin-1-yl)-4-oxobutanoic acid;ethane |
| SMILES | CC.N#CC1CC(F)(F)CN1C(=O)CCC(=O)O |
| InChI | InChI=1S/C9H10F2N2O3.C2H6/c10-9(11)3-6(4-12)13(5-9)7(14)1-2-8(15)16;1-2/h6H,1-3,5H2,(H,15,16);1-2H3 |
| InChIKey | KUJOFPNZJGVNEM-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 81.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.26 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-(2-cyano-4,4-difluoropyrrolidin-1-yl)-4-oxobutanoic acid;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2-cyano-4,4-difluoropyrrolidin-1-yl)-4-oxobutanoic acid;ethane?
The IUPAC name of 4-(2-cyano-4,4-difluoropyrrolidin-1-yl)-4-oxobutanoic acid;ethane (CID 169106255) is 4-(2-cyano-4,4-difluoropyrrolidin-1-yl)-4-oxobutanoic acid;ethane.
What is the SMILES notation for 4-(2-cyano-4,4-difluoropyrrolidin-1-yl)-4-oxobutanoic acid;ethane?
The canonical SMILES for 4-(2-cyano-4,4-difluoropyrrolidin-1-yl)-4-oxobutanoic acid;ethane is CC.N#CC1CC(F)(F)CN1C(=O)CCC(=O)O.
What is the InChIKey of 4-(2-cyano-4,4-difluoropyrrolidin-1-yl)-4-oxobutanoic acid;ethane?
The InChIKey is KUJOFPNZJGVNEM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10F2N2O3.C2H6/c10-9(11)3-6(4-12)13(5-9)7(14)1-2-8(15)16;1-2/h6H,1-3,5H2,(H,15,16);1-2H3.
What are the key properties of 4-(2-cyano-4,4-difluoropyrrolidin-1-yl)-4-oxobutanoic acid;ethane?
4-(2-cyano-4,4-difluoropyrrolidin-1-yl)-4-oxobutanoic acid;ethane has a molecular weight of 262.26 g/mol, XLogP of 1.64, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-cyano-4,4-difluoropyrrolidin-1-yl)-4-oxobutanoic acid;ethane is sourced from PubChem (CID 169106255), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).