C7H4N4S — CID 169106391
7-thia-2,4,5,9-tetrazatricyclo[6.4.0.02,6]dodeca-1(8),3,5,9,11-pentaene (PubChem CID 169106391) has the molecular formula C7H4N4S and a molecular weight of 176.20 g/mol. Its IUPAC name is 7-thia-2,4,5,9-tetrazatricyclo[6.4.0.02,6]dodeca-1(8),3,5,9,11-pentaene.
| Compound Name | 7-thia-2,4,5,9-tetrazatricyclo[6.4.0.02,6]dodeca-1(8),3,5,9,11-pentaene |
|---|---|
| PubChem CID | 169106391 |
| Molecular Formula | C7H4N4S |
| Molecular Weight | 176.20 g/mol |
| Exact Mass | 176.02 |
| IUPAC Name | 7-thia-2,4,5,9-tetrazatricyclo[6.4.0.02,6]dodeca-1(8),3,5,9,11-pentaene |
| SMILES | c1cnc2sc3nncn3c2c1 |
| InChI | InChI=1S/C7H4N4S/c1-2-5-6(8-3-1)12-7-10-9-4-11(5)7/h1-4H |
| InChIKey | BWUXIJDVEDHHRT-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 43.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.20 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |