C28H40N2 — CID 169106407
1-(3-ethyl-2,4,7-trimethylcyclohepta-1,3,6-trien-1-yl)-2-propan-2-yl-3-(2,3,4,6-tetramethylphenyl)-2H-imidazole (PubChem CID 169106407) has the molecular formula C28H40N2 and a molecular weight of 404.64 g/mol. Its IUPAC name is 1-(3-ethyl-2,4,7-trimethylcyclohepta-1,3,6-trien-1-yl)-2-propan-2-yl-3-(2,3,4,6-tetramethylphenyl)-2H-imidazole.
| Compound Name | 1-(3-ethyl-2,4,7-trimethylcyclohepta-1,3,6-trien-1-yl)-2-propan-2-yl-3-(2,3,4,6-tetramethylphenyl)-2H-imidazole |
|---|---|
| PubChem CID | 169106407 |
| Molecular Formula | C28H40N2 |
| Molecular Weight | 404.64 g/mol |
| Exact Mass | 404.32 |
| IUPAC Name | 1-(3-ethyl-2,4,7-trimethylcyclohepta-1,3,6-trien-1-yl)-2-propan-2-yl-3-(2,3,4,6-tetramethylphenyl)-2H-imidazole |
| SMILES | CCC1=C(C)CC=C(C)C(N2C=CN(c3c(C)cc(C)c(C)c3C)C2C(C)C)=C1C |
| InChI | InChI=1S/C28H40N2/c1-11-25-18(4)12-13-19(5)26(24(25)10)29-14-15-30(28(29)17(2)3)27-21(7)16-20(6)22(8)23(27)9/h13-17,28H,11-12H2,1-10H3 |
| InChIKey | VBMFGXSZHNQWIX-UHFFFAOYSA-N |
| XLogP | 7.85 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.64 |
| LogP ≤ 5 | 7.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |