C13H22O4S — CID 169106869
(2R)-2-[(2,2-dimethyl-1,3-dioxolan-4-yl)methyl]-3,3a,4,6,7,7a-hexahydro-2H-thiopyrano[4,3-b]furan-3-ol (PubChem CID 169106869) has the molecular formula C13H22O4S and a molecular weight of 274.38 g/mol. Its IUPAC name is (2R)-2-[(2,2-dimethyl-1,3-dioxolan-4-yl)methyl]-3,3a,4,6,7,7a-hexahydro-2H-thiopyrano[4,3-b]furan-3-ol.
| Compound Name | (2R)-2-[(2,2-dimethyl-1,3-dioxolan-4-yl)methyl]-3,3a,4,6,7,7a-hexahydro-2H-thiopyrano[4,3-b]furan-3-ol |
|---|---|
| PubChem CID | 169106869 |
| Molecular Formula | C13H22O4S |
| Molecular Weight | 274.38 g/mol |
| Exact Mass | 274.12 |
| IUPAC Name | (2R)-2-[(2,2-dimethyl-1,3-dioxolan-4-yl)methyl]-3,3a,4,6,7,7a-hexahydro-2H-thiopyrano[4,3-b]furan-3-ol |
| SMILES | CC1(C)OCC(C[C@H]2OC3CCSCC3C2O)O1 |
| InChI | InChI=1S/C13H22O4S/c1-13(2)15-6-8(17-13)5-11-12(14)9-7-18-4-3-10(9)16-11/h8-12,14H,3-7H2,1-2H3/t8?,9?,10?,11-,12?/m1/s1 |
| InChIKey | ITNPVYFFXGXPKR-LTMLNTECSA-N |
| XLogP | 1.41 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.38 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |