About CID 169106988
CID 169106988 (PubChem CID 169106988) has the molecular formula C21H21CfN4O4S-
and a molecular weight of 676.49 g/mol.
Molecular Properties
| Compound Name | CID 169106988 |
| PubChem CID | 169106988 |
| Molecular Formula | C21H21CfN4O4S- |
| Molecular Weight | 676.49 g/mol |
| Exact Mass | 674.20 |
| IUPAC Name | — |
| SMILES | Cc1cccc(N(Cc2ccc(-c3nn[c-]o3)cc2)C(=O)N2CCS(=O)(=O)CC2)c1.[Cf] |
| InChI | InChI=1S/C21H21N4O4S.Cf/c1-16-3-2-4-19(13-16)25(21(26)24-9-11-30(27,28)12-10-24)14-17-5-7-18(8-6-17)20-23-22-15-29-20;/h2-8,13H,9-12,14H2,1H3;/q-1; |
| InChIKey | RZYXMLTWUDYULB-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 96.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 676.49 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze CID 169106988 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 169106988?
The IUPAC name of CID 169106988 (CID 169106988) is not available.
What is the SMILES notation for CID 169106988?
The canonical SMILES for CID 169106988 is Cc1cccc(N(Cc2ccc(-c3nn[c-]o3)cc2)C(=O)N2CCS(=O)(=O)CC2)c1.[Cf].
What is the InChIKey of CID 169106988?
The InChIKey is RZYXMLTWUDYULB-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H21N4O4S.Cf/c1-16-3-2-4-19(13-16)25(21(26)24-9-11-30(27,28)12-10-24)14-17-5-7-18(8-6-17)20-23-22-15-29-20;/h2-8,13H,9-12,14H2,1H3;/q-1;.
What are the key properties of CID 169106988?
CID 169106988 has a molecular weight of 676.49 g/mol, XLogP of 2.70, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for CID 169106988 is sourced from PubChem (CID 169106988), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).