C21H21FN4O3S — CID 169107141
6-fluoro-3-[1-[3-[[4-(1,3-oxazol-5-yl)-1,3-thiazol-2-yl]oxy]propyl]piperidin-4-yl]-1,2-benzoxazole (PubChem CID 169107141) has the molecular formula C21H21FN4O3S and a molecular weight of 428.49 g/mol. Its IUPAC name is 6-fluoro-3-[1-[3-[[4-(1,3-oxazol-5-yl)-1,3-thiazol-2-yl]oxy]propyl]piperidin-4-yl]-1,2-benzoxazole.
| Compound Name | 6-fluoro-3-[1-[3-[[4-(1,3-oxazol-5-yl)-1,3-thiazol-2-yl]oxy]propyl]piperidin-4-yl]-1,2-benzoxazole |
|---|---|
| PubChem CID | 169107141 |
| Molecular Formula | C21H21FN4O3S |
| Molecular Weight | 428.49 g/mol |
| Exact Mass | 428.13 |
| IUPAC Name | 6-fluoro-3-[1-[3-[[4-(1,3-oxazol-5-yl)-1,3-thiazol-2-yl]oxy]propyl]piperidin-4-yl]-1,2-benzoxazole |
| SMILES | Fc1ccc2c(C3CCN(CCCOc4nc(-c5cnco5)cs4)CC3)noc2c1 |
| InChI | InChI=1S/C21H21FN4O3S/c22-15-2-3-16-18(10-15)29-25-20(16)14-4-7-26(8-5-14)6-1-9-27-21-24-17(12-30-21)19-11-23-13-28-19/h2-3,10-14H,1,4-9H2 |
| InChIKey | SPUDGYNEGKKPAW-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 77.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.49 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|