C35H66N2O — CID 169107465
3-ethyl-N-[[(6Z,15Z)-henicosa-6,15-dien-11-ylidene]amino]dodecanamide (PubChem CID 169107465) has the molecular formula C35H66N2O and a molecular weight of 530.93 g/mol. Its IUPAC name is 3-ethyl-N-[[(6Z,15Z)-henicosa-6,15-dien-11-ylidene]amino]dodecanamide.
| Compound Name | 3-ethyl-N-[[(6Z,15Z)-henicosa-6,15-dien-11-ylidene]amino]dodecanamide |
|---|---|
| PubChem CID | 169107465 |
| Molecular Formula | C35H66N2O |
| Molecular Weight | 530.93 g/mol |
| Exact Mass | 530.52 |
| IUPAC Name | 3-ethyl-N-[[(6Z,15Z)-henicosa-6,15-dien-11-ylidene]amino]dodecanamide |
| SMILES | CCCCC/C=C\CCCC(CCC/C=C\CCCCC)=NNC(=O)CC(CC)CCCCCCCCC |
| InChI | InChI=1S/C35H66N2O/c1-5-9-12-15-18-21-24-27-30-34(31-28-25-22-19-16-13-10-6-2)36-37-35(38)32-33(8-4)29-26-23-20-17-14-11-7-3/h18-19,21-22,33H,5-17,20,23-32H2,1-4H3,(H,37,38)/b21-18-,22-19- |
| InChIKey | IUPDWQYJVLKBOT-FRRVGIRPSA-N |
| XLogP | 11.63 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.93 |
| LogP ≤ 5 | 11.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|