C34H64N2O — CID 169107701
N-[[(6Z,15Z)-henicosa-6,15-dien-11-ylidene]amino]-3-methyldodecanamide (PubChem CID 169107701) has the molecular formula C34H64N2O and a molecular weight of 516.90 g/mol. Its IUPAC name is N-[[(6Z,15Z)-henicosa-6,15-dien-11-ylidene]amino]-3-methyldodecanamide.
| Compound Name | N-[[(6Z,15Z)-henicosa-6,15-dien-11-ylidene]amino]-3-methyldodecanamide |
|---|---|
| PubChem CID | 169107701 |
| Molecular Formula | C34H64N2O |
| Molecular Weight | 516.90 g/mol |
| Exact Mass | 516.50 |
| IUPAC Name | N-[[(6Z,15Z)-henicosa-6,15-dien-11-ylidene]amino]-3-methyldodecanamide |
| SMILES | CCCCC/C=C\CCCC(CCC/C=C\CCCCC)=NNC(=O)CC(C)CCCCCCCCC |
| InChI | InChI=1S/C34H64N2O/c1-5-8-11-14-17-20-23-26-29-33(30-27-24-21-18-15-12-9-6-2)35-36-34(37)31-32(4)28-25-22-19-16-13-10-7-3/h17-18,20-21,32H,5-16,19,22-31H2,1-4H3,(H,36,37)/b20-17-,21-18- |
| InChIKey | GAIJSYLBLAVNBD-HIOQQWDOSA-N |
| XLogP | 11.24 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.90 |
| LogP ≤ 5 | 11.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|