About 3-(2-prop-2-ynoxy-1,4-dihydropyrimidin-5-yl)-N-[4-(trifluoromethyl)phenyl]pyrazin-2-amine
3-(2-prop-2-ynoxy-1,4-dihydropyrimidin-5-yl)-N-[4-(trifluoromethyl)phenyl]pyrazin-2-amine (PubChem CID 169108264) has the molecular formula C18H14F3N5O
and a molecular weight of 373.34 g/mol. Its IUPAC name is 3-(2-prop-2-ynoxy-1,4-dihydropyrimidin-5-yl)-N-[4-(trifluoromethyl)phenyl]pyrazin-2-amine.
Molecular Properties
| Compound Name | 3-(2-prop-2-ynoxy-1,4-dihydropyrimidin-5-yl)-N-[4-(trifluoromethyl)phenyl]pyrazin-2-amine |
| PubChem CID | 169108264 |
| Molecular Formula | C18H14F3N5O |
| Molecular Weight | 373.34 g/mol |
| Exact Mass | 373.12 |
| IUPAC Name | 3-(2-prop-2-ynoxy-1,4-dihydropyrimidin-5-yl)-N-[4-(trifluoromethyl)phenyl]pyrazin-2-amine |
| SMILES | C#CCOC1=NCC(c2nccnc2Nc2ccc(C(F)(F)F)cc2)=CN1 |
| InChI | InChI=1S/C18H14F3N5O/c1-2-9-27-17-24-10-12(11-25-17)15-16(23-8-7-22-15)26-14-5-3-13(4-6-14)18(19,20)21/h1,3-8,10H,9,11H2,(H,23,26)(H,24,25) |
| InChIKey | GGRQOGGUKGOWAQ-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 71.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 373.34 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-(2-prop-2-ynoxy-1,4-dihydropyrimidin-5-yl)-N-[4-(trifluoromethyl)phenyl]pyrazin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2-prop-2-ynoxy-1,4-dihydropyrimidin-5-yl)-N-[4-(trifluoromethyl)phenyl]pyrazin-2-amine?
The IUPAC name of 3-(2-prop-2-ynoxy-1,4-dihydropyrimidin-5-yl)-N-[4-(trifluoromethyl)phenyl]pyrazin-2-amine (CID 169108264) is 3-(2-prop-2-ynoxy-1,4-dihydropyrimidin-5-yl)-N-[4-(trifluoromethyl)phenyl]pyrazin-2-amine.
What is the SMILES notation for 3-(2-prop-2-ynoxy-1,4-dihydropyrimidin-5-yl)-N-[4-(trifluoromethyl)phenyl]pyrazin-2-amine?
The canonical SMILES for 3-(2-prop-2-ynoxy-1,4-dihydropyrimidin-5-yl)-N-[4-(trifluoromethyl)phenyl]pyrazin-2-amine is C#CCOC1=NCC(c2nccnc2Nc2ccc(C(F)(F)F)cc2)=CN1.
What is the InChIKey of 3-(2-prop-2-ynoxy-1,4-dihydropyrimidin-5-yl)-N-[4-(trifluoromethyl)phenyl]pyrazin-2-amine?
The InChIKey is GGRQOGGUKGOWAQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H14F3N5O/c1-2-9-27-17-24-10-12(11-25-17)15-16(23-8-7-22-15)26-14-5-3-13(4-6-14)18(19,20)21/h1,3-8,10H,9,11H2,(H,23,26)(H,24,25).
What are the key properties of 3-(2-prop-2-ynoxy-1,4-dihydropyrimidin-5-yl)-N-[4-(trifluoromethyl)phenyl]pyrazin-2-amine?
3-(2-prop-2-ynoxy-1,4-dihydropyrimidin-5-yl)-N-[4-(trifluoromethyl)phenyl]pyrazin-2-amine has a molecular weight of 373.34 g/mol, XLogP of 3.19, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2-prop-2-ynoxy-1,4-dihydropyrimidin-5-yl)-N-[4-(trifluoromethyl)phenyl]pyrazin-2-amine is sourced from PubChem (CID 169108264), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).