About ethane;4-[2-[4-(pentafluoro-λ6-sulfanyl)anilino]-3-pyridinyl]benzoic acid
ethane;4-[2-[4-(pentafluoro-λ6-sulfanyl)anilino]-3-pyridinyl]benzoic acid (PubChem CID 169108611) has the molecular formula C20H19F5N2O2S
and a molecular weight of 446.44 g/mol. Its IUPAC name is ethane;4-[2-[4-(pentafluoro-λ6-sulfanyl)anilino]-3-pyridinyl]benzoic acid.
Molecular Properties
| Compound Name | ethane;4-[2-[4-(pentafluoro-λ6-sulfanyl)anilino]-3-pyridinyl]benzoic acid |
| PubChem CID | 169108611 |
| Molecular Formula | C20H19F5N2O2S |
| Molecular Weight | 446.44 g/mol |
| Exact Mass | 446.11 |
| IUPAC Name | ethane;4-[2-[4-(pentafluoro-λ6-sulfanyl)anilino]-3-pyridinyl]benzoic acid |
| SMILES | CC.O=C(O)c1ccc(-c2cccnc2Nc2ccc(S(F)(F)(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C18H13F5N2O2S.C2H6/c19-28(20,21,22,23)15-9-7-14(8-10-15)25-17-16(2-1-11-24-17)12-3-5-13(6-4-12)18(26)27;1-2/h1-11H,(H,24,25)(H,26,27);1-2H3 |
| InChIKey | KIPSAFAXXZDCLX-UHFFFAOYSA-N |
| XLogP | 7.87 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 446.44 |
| LogP ≤ 5 | 7.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethane;4-[2-[4-(pentafluoro-λ6-sulfanyl)anilino]-3-pyridinyl]benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;4-[2-[4-(pentafluoro-λ6-sulfanyl)anilino]-3-pyridinyl]benzoic acid?
The IUPAC name of ethane;4-[2-[4-(pentafluoro-λ6-sulfanyl)anilino]-3-pyridinyl]benzoic acid (CID 169108611) is ethane;4-[2-[4-(pentafluoro-λ6-sulfanyl)anilino]-3-pyridinyl]benzoic acid.
What is the SMILES notation for ethane;4-[2-[4-(pentafluoro-λ6-sulfanyl)anilino]-3-pyridinyl]benzoic acid?
The canonical SMILES for ethane;4-[2-[4-(pentafluoro-λ6-sulfanyl)anilino]-3-pyridinyl]benzoic acid is CC.O=C(O)c1ccc(-c2cccnc2Nc2ccc(S(F)(F)(F)(F)F)cc2)cc1.
What is the InChIKey of ethane;4-[2-[4-(pentafluoro-λ6-sulfanyl)anilino]-3-pyridinyl]benzoic acid?
The InChIKey is KIPSAFAXXZDCLX-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H13F5N2O2S.C2H6/c19-28(20,21,22,23)15-9-7-14(8-10-15)25-17-16(2-1-11-24-17)12-3-5-13(6-4-12)18(26)27;1-2/h1-11H,(H,24,25)(H,26,27);1-2H3.
What are the key properties of ethane;4-[2-[4-(pentafluoro-λ6-sulfanyl)anilino]-3-pyridinyl]benzoic acid?
ethane;4-[2-[4-(pentafluoro-λ6-sulfanyl)anilino]-3-pyridinyl]benzoic acid has a molecular weight of 446.44 g/mol, XLogP of 7.87, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;4-[2-[4-(pentafluoro-λ6-sulfanyl)anilino]-3-pyridinyl]benzoic acid is sourced from PubChem (CID 169108611), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).