C16H19ClN2O3 — CID 169109263
tert-butyl 1-[(5-chloro-2-methoxyphenyl)methyl]pyrazole-4-carboxylate (PubChem CID 169109263) has the molecular formula C16H19ClN2O3 and a molecular weight of 322.79 g/mol. Its IUPAC name is tert-butyl 1-[(5-chloro-2-methoxyphenyl)methyl]pyrazole-4-carboxylate.
| Compound Name | tert-butyl 1-[(5-chloro-2-methoxyphenyl)methyl]pyrazole-4-carboxylate |
|---|---|
| PubChem CID | 169109263 |
| Molecular Formula | C16H19ClN2O3 |
| Molecular Weight | 322.79 g/mol |
| Exact Mass | 322.11 |
| IUPAC Name | tert-butyl 1-[(5-chloro-2-methoxyphenyl)methyl]pyrazole-4-carboxylate |
| SMILES | COc1ccc(Cl)cc1Cn1cc(C(=O)OC(C)(C)C)cn1 |
| InChI | InChI=1S/C16H19ClN2O3/c1-16(2,3)22-15(20)12-8-18-19(10-12)9-11-7-13(17)5-6-14(11)21-4/h5-8,10H,9H2,1-4H3 |
| InChIKey | YKZIQQGZJMTJFF-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.79 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |