C28H35N3O — CID 169109482
1-(2-aminopentyl)-3-methyl-3-phenyl-1-[4-(4-propylphenyl)phenyl]urea (PubChem CID 169109482) has the molecular formula C28H35N3O and a molecular weight of 429.61 g/mol. Its IUPAC name is 1-(2-aminopentyl)-3-methyl-3-phenyl-1-[4-(4-propylphenyl)phenyl]urea.
| Compound Name | 1-(2-aminopentyl)-3-methyl-3-phenyl-1-[4-(4-propylphenyl)phenyl]urea |
|---|---|
| PubChem CID | 169109482 |
| Molecular Formula | C28H35N3O |
| Molecular Weight | 429.61 g/mol |
| Exact Mass | 429.28 |
| IUPAC Name | 1-(2-aminopentyl)-3-methyl-3-phenyl-1-[4-(4-propylphenyl)phenyl]urea |
| SMILES | CCCc1ccc(-c2ccc(N(CC(N)CCC)C(=O)N(C)c3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C28H35N3O/c1-4-9-22-13-15-23(16-14-22)24-17-19-27(20-18-24)31(21-25(29)10-5-2)28(32)30(3)26-11-7-6-8-12-26/h6-8,11-20,25H,4-5,9-10,21,29H2,1-3H3 |
| InChIKey | WTPKECDKBKTASD-UHFFFAOYSA-N |
| XLogP | 6.50 |
| TPSA | 49.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.61 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |