C31H43ClN10O2 — CID 169109657
3,5-diamino-N-[N'-[4-[4-[4-[3-[[(2S)-2-amino-4-(dimethylamino)butanoyl]amino]propyl]phenyl]phenyl]butyl]carbamimidoyl]-6-chloropyrazine-2-carboxamide (PubChem CID 169109657) has the molecular formula C31H43ClN10O2 and a molecular weight of 623.21 g/mol. Its IUPAC name is 3,5-diamino-N-[N'-[4-[4-[4-[3-[[(2S)-2-amino-4-(dimethylamino)butanoyl]amino]propyl]phenyl]phenyl]butyl]carbamimidoyl]-6-chloropyrazine-2-carboxamide.
| Compound Name | 3,5-diamino-N-[N'-[4-[4-[4-[3-[[(2S)-2-amino-4-(dimethylamino)butanoyl]amino]propyl]phenyl]phenyl]butyl]carbamimidoyl]-6-chloropyrazine-2-carboxamide |
|---|---|
| PubChem CID | 169109657 |
| Molecular Formula | C31H43ClN10O2 |
| Molecular Weight | 623.21 g/mol |
| Exact Mass | 622.33 |
| IUPAC Name | 3,5-diamino-N-[N'-[4-[4-[4-[3-[[(2S)-2-amino-4-(dimethylamino)butanoyl]amino]propyl]phenyl]phenyl]butyl]carbamimidoyl]-6-chloropyrazine-2-carboxamide |
| SMILES | CN(C)CC[C@H](N)C(=O)NCCCc1ccc(-c2ccc(CCCC/N=C(\N)NC(=O)c3nc(Cl)c(N)nc3N)cc2)cc1 |
| InChI | InChI=1S/C31H43ClN10O2/c1-42(2)19-16-24(33)29(43)37-18-5-7-21-10-14-23(15-11-21)22-12-8-20(9-13-22)6-3-4-17-38-31(36)41-30(44)25-27(34)40-28(35)26(32)39-25/h8-15,24H,3-7,16-19,33H2,1-2H3,(H,37,43)(H4,34,35,40)(H3,36,38,41,44)/t24-/m0/s1 |
| InChIKey | SORYREZICRZPKU-DEOSSOPVSA-N |
| XLogP | 2.36 |
| TPSA | 203.66 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.21 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|