C31H40ClN9O4 — CID 169109686
(2R)-6-amino-2-[3-[4-[4-[4-[[amino-[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]methylidene]amino]butyl]phenyl]phenyl]propanoylamino]hexanoic acid (PubChem CID 169109686) has the molecular formula C31H40ClN9O4 and a molecular weight of 638.17 g/mol. Its IUPAC name is (2R)-6-amino-2-[3-[4-[4-[4-[[amino-[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]methylidene]amino]butyl]phenyl]phenyl]propanoylamino]hexanoic acid.
| Compound Name | (2R)-6-amino-2-[3-[4-[4-[4-[[amino-[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]methylidene]amino]butyl]phenyl]phenyl]propanoylamino]hexanoic acid |
|---|---|
| PubChem CID | 169109686 |
| Molecular Formula | C31H40ClN9O4 |
| Molecular Weight | 638.17 g/mol |
| Exact Mass | 637.29 |
| IUPAC Name | (2R)-6-amino-2-[3-[4-[4-[4-[[amino-[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]methylidene]amino]butyl]phenyl]phenyl]propanoylamino]hexanoic acid |
| SMILES | NCCCC[C@@H](NC(=O)CCc1ccc(-c2ccc(CCCC/N=C(\N)NC(=O)c3nc(Cl)c(N)nc3N)cc2)cc1)C(=O)O |
| InChI | InChI=1S/C31H40ClN9O4/c32-26-28(35)40-27(34)25(39-26)29(43)41-31(36)37-18-4-2-5-19-7-12-21(13-8-19)22-14-9-20(10-15-22)11-16-24(42)38-23(30(44)45)6-1-3-17-33/h7-10,12-15,23H,1-6,11,16-18,33H2,(H,38,42)(H,44,45)(H4,34,35,40)(H3,36,37,41,43)/t23-/m1/s1 |
| InChIKey | SYLFTROIFREGFK-HSZRJFAPSA-N |
| XLogP | 2.66 |
| TPSA | 237.72 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.17 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|