C34H40ClN9O2 — CID 169109738
3,5-diamino-N-[N'-[4-[4-[4-[3-[[(2S)-2-amino-3-phenylpropanoyl]amino]propyl]phenyl]phenyl]butyl]carbamimidoyl]-6-chloropyrazine-2-carboxamide (PubChem CID 169109738) has the molecular formula C34H40ClN9O2 and a molecular weight of 642.21 g/mol. Its IUPAC name is 3,5-diamino-N-[N'-[4-[4-[4-[3-[[(2S)-2-amino-3-phenylpropanoyl]amino]propyl]phenyl]phenyl]butyl]carbamimidoyl]-6-chloropyrazine-2-carboxamide.
| Compound Name | 3,5-diamino-N-[N'-[4-[4-[4-[3-[[(2S)-2-amino-3-phenylpropanoyl]amino]propyl]phenyl]phenyl]butyl]carbamimidoyl]-6-chloropyrazine-2-carboxamide |
|---|---|
| PubChem CID | 169109738 |
| Molecular Formula | C34H40ClN9O2 |
| Molecular Weight | 642.21 g/mol |
| Exact Mass | 641.30 |
| IUPAC Name | 3,5-diamino-N-[N'-[4-[4-[4-[3-[[(2S)-2-amino-3-phenylpropanoyl]amino]propyl]phenyl]phenyl]butyl]carbamimidoyl]-6-chloropyrazine-2-carboxamide |
| SMILES | N/C(=N\CCCCc1ccc(-c2ccc(CCCNC(=O)[C@@H](N)Cc3ccccc3)cc2)cc1)NC(=O)c1nc(Cl)c(N)nc1N |
| InChI | InChI=1S/C34H40ClN9O2/c35-29-31(38)43-30(37)28(42-29)33(46)44-34(39)41-19-5-4-7-22-11-15-25(16-12-22)26-17-13-23(14-18-26)10-6-20-40-32(45)27(36)21-24-8-2-1-3-9-24/h1-3,8-9,11-18,27H,4-7,10,19-21,36H2,(H,40,45)(H4,37,38,43)(H3,39,41,44,46)/t27-/m0/s1 |
| InChIKey | YBHVGJLYZYKMTJ-MHZLTWQESA-N |
| XLogP | 3.65 |
| TPSA | 200.42 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.21 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|