C31H38ClN9O4 — CID 169109742
methyl (2R)-1-[3-[4-[4-[4-[[amino-[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]methylidene]amino]butyl]phenyl]phenyl]propanoyl]piperazine-2-carboxylate (PubChem CID 169109742) has the molecular formula C31H38ClN9O4 and a molecular weight of 636.16 g/mol. Its IUPAC name is methyl (2R)-1-[3-[4-[4-[4-[[amino-[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]methylidene]amino]butyl]phenyl]phenyl]propanoyl]piperazine-2-carboxylate.
| Compound Name | methyl (2R)-1-[3-[4-[4-[4-[[amino-[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]methylidene]amino]butyl]phenyl]phenyl]propanoyl]piperazine-2-carboxylate |
|---|---|
| PubChem CID | 169109742 |
| Molecular Formula | C31H38ClN9O4 |
| Molecular Weight | 636.16 g/mol |
| Exact Mass | 635.27 |
| IUPAC Name | methyl (2R)-1-[3-[4-[4-[4-[[amino-[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]methylidene]amino]butyl]phenyl]phenyl]propanoyl]piperazine-2-carboxylate |
| SMILES | COC(=O)[C@H]1CNCCN1C(=O)CCc1ccc(-c2ccc(CCCC/N=C(\N)NC(=O)c3nc(Cl)c(N)nc3N)cc2)cc1 |
| InChI | InChI=1S/C31H38ClN9O4/c1-45-30(44)23-18-36-16-17-41(23)24(42)14-9-20-7-12-22(13-8-20)21-10-5-19(6-11-21)4-2-3-15-37-31(35)40-29(43)25-27(33)39-28(34)26(32)38-25/h5-8,10-13,23,36H,2-4,9,14-18H2,1H3,(H4,33,34,39)(H3,35,37,40,43)/t23-/m1/s1 |
| InChIKey | ZVYIHOLYSHGHRG-HSZRJFAPSA-N |
| XLogP | 1.93 |
| TPSA | 203.94 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.16 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|