C30H36ClN9O4 — CID 169109746
(2R)-1-[3-[4-[4-[4-[[amino-[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]methylidene]amino]butyl]phenyl]phenyl]propanoyl]piperazine-2-carboxylic acid (PubChem CID 169109746) has the molecular formula C30H36ClN9O4 and a molecular weight of 622.13 g/mol. Its IUPAC name is (2R)-1-[3-[4-[4-[4-[[amino-[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]methylidene]amino]butyl]phenyl]phenyl]propanoyl]piperazine-2-carboxylic acid.
| Compound Name | (2R)-1-[3-[4-[4-[4-[[amino-[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]methylidene]amino]butyl]phenyl]phenyl]propanoyl]piperazine-2-carboxylic acid |
|---|---|
| PubChem CID | 169109746 |
| Molecular Formula | C30H36ClN9O4 |
| Molecular Weight | 622.13 g/mol |
| Exact Mass | 621.26 |
| IUPAC Name | (2R)-1-[3-[4-[4-[4-[[amino-[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]methylidene]amino]butyl]phenyl]phenyl]propanoyl]piperazine-2-carboxylic acid |
| SMILES | N/C(=N\CCCCc1ccc(-c2ccc(CCC(=O)N3CCNC[C@@H]3C(=O)O)cc2)cc1)NC(=O)c1nc(Cl)c(N)nc1N |
| InChI | InChI=1S/C30H36ClN9O4/c31-25-27(33)38-26(32)24(37-25)28(42)39-30(34)36-14-2-1-3-18-4-9-20(10-5-18)21-11-6-19(7-12-21)8-13-23(41)40-16-15-35-17-22(40)29(43)44/h4-7,9-12,22,35H,1-3,8,13-17H2,(H,43,44)(H4,32,33,38)(H3,34,36,39,42)/t22-/m1/s1 |
| InChIKey | LZBJJHJUNUJVOZ-JOCHJYFZSA-N |
| XLogP | 1.85 |
| TPSA | 214.94 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.13 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|