C35H48ClN9O5 — CID 169109749
methyl (2S)-2-[3-[4-[4-[4-[[amino-[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]methylidene]amino]butyl]phenyl]phenyl]propanoyl-methylamino]-6-(2-hydroxyethylamino)hexanoate (PubChem CID 169109749) has the molecular formula C35H48ClN9O5 and a molecular weight of 710.28 g/mol. Its IUPAC name is methyl (2S)-2-[3-[4-[4-[4-[[amino-[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]methylidene]amino]butyl]phenyl]phenyl]propanoyl-methylamino]-6-(2-hydroxyethylamino)hexanoate.
| Compound Name | methyl (2S)-2-[3-[4-[4-[4-[[amino-[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]methylidene]amino]butyl]phenyl]phenyl]propanoyl-methylamino]-6-(2-hydroxyethylamino)hexanoate |
|---|---|
| PubChem CID | 169109749 |
| Molecular Formula | C35H48ClN9O5 |
| Molecular Weight | 710.28 g/mol |
| Exact Mass | 709.35 |
| IUPAC Name | methyl (2S)-2-[3-[4-[4-[4-[[amino-[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]methylidene]amino]butyl]phenyl]phenyl]propanoyl-methylamino]-6-(2-hydroxyethylamino)hexanoate |
| SMILES | COC(=O)[C@H](CCCCNCCO)N(C)C(=O)CCc1ccc(-c2ccc(CCCC/N=C(\N)NC(=O)c3nc(Cl)c(N)nc3N)cc2)cc1 |
| InChI | InChI=1S/C35H48ClN9O5/c1-45(27(34(49)50-2)8-4-5-19-40-21-22-46)28(47)18-13-24-11-16-26(17-12-24)25-14-9-23(10-15-25)7-3-6-20-41-35(39)44-33(48)29-31(37)43-32(38)30(36)42-29/h9-12,14-17,27,40,46H,3-8,13,18-22H2,1-2H3,(H4,37,38,43)(H3,39,41,44,48)/t27-/m0/s1 |
| InChIKey | BTPDVVXAHPOQAT-MHZLTWQESA-N |
| XLogP | 2.71 |
| TPSA | 224.17 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 50 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 710.28 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|