C33H43ClN10O3 — CID 169109752
3,5-diamino-N-[N'-[4-[4-[4-[3-[(2S)-2-(4-aminobutyl)-3-oxopiperazin-1-yl]-3-oxopropyl]phenyl]phenyl]butyl]carbamimidoyl]-6-chloropyrazine-2-carboxamide (PubChem CID 169109752) has the molecular formula C33H43ClN10O3 and a molecular weight of 663.23 g/mol. Its IUPAC name is 3,5-diamino-N-[N'-[4-[4-[4-[3-[(2S)-2-(4-aminobutyl)-3-oxopiperazin-1-yl]-3-oxopropyl]phenyl]phenyl]butyl]carbamimidoyl]-6-chloropyrazine-2-carboxamide.
| Compound Name | 3,5-diamino-N-[N'-[4-[4-[4-[3-[(2S)-2-(4-aminobutyl)-3-oxopiperazin-1-yl]-3-oxopropyl]phenyl]phenyl]butyl]carbamimidoyl]-6-chloropyrazine-2-carboxamide |
|---|---|
| PubChem CID | 169109752 |
| Molecular Formula | C33H43ClN10O3 |
| Molecular Weight | 663.23 g/mol |
| Exact Mass | 662.32 |
| IUPAC Name | 3,5-diamino-N-[N'-[4-[4-[4-[3-[(2S)-2-(4-aminobutyl)-3-oxopiperazin-1-yl]-3-oxopropyl]phenyl]phenyl]butyl]carbamimidoyl]-6-chloropyrazine-2-carboxamide |
| SMILES | NCCCC[C@H]1C(=O)NCCN1C(=O)CCc1ccc(-c2ccc(CCCC/N=C(\N)NC(=O)c3nc(Cl)c(N)nc3N)cc2)cc1 |
| InChI | InChI=1S/C33H43ClN10O3/c34-28-30(37)42-29(36)27(41-28)32(47)43-33(38)40-18-4-2-5-21-7-12-23(13-8-21)24-14-9-22(10-15-24)11-16-26(45)44-20-19-39-31(46)25(44)6-1-3-17-35/h7-10,12-15,25H,1-6,11,16-20,35H2,(H,39,46)(H4,36,37,42)(H3,38,40,43,47)/t25-/m0/s1 |
| InChIKey | JHKWAYFAUIAPTB-VWLOTQADSA-N |
| XLogP | 2.42 |
| TPSA | 220.73 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 663.23 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|