C31H41ClN10O3 — CID 169109793
3,5-diamino-6-chloro-N-[N'-[4-[4-[4-[3-[[(2R)-1,6-diamino-1-oxohexan-2-yl]amino]-3-oxopropyl]phenyl]phenyl]butyl]carbamimidoyl]pyrazine-2-carboxamide (PubChem CID 169109793) has the molecular formula C31H41ClN10O3 and a molecular weight of 637.19 g/mol. Its IUPAC name is 3,5-diamino-6-chloro-N-[N'-[4-[4-[4-[3-[[(2R)-1,6-diamino-1-oxohexan-2-yl]amino]-3-oxopropyl]phenyl]phenyl]butyl]carbamimidoyl]pyrazine-2-carboxamide.
| Compound Name | 3,5-diamino-6-chloro-N-[N'-[4-[4-[4-[3-[[(2R)-1,6-diamino-1-oxohexan-2-yl]amino]-3-oxopropyl]phenyl]phenyl]butyl]carbamimidoyl]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 169109793 |
| Molecular Formula | C31H41ClN10O3 |
| Molecular Weight | 637.19 g/mol |
| Exact Mass | 636.31 |
| IUPAC Name | 3,5-diamino-6-chloro-N-[N'-[4-[4-[4-[3-[[(2R)-1,6-diamino-1-oxohexan-2-yl]amino]-3-oxopropyl]phenyl]phenyl]butyl]carbamimidoyl]pyrazine-2-carboxamide |
| SMILES | NCCCC[C@@H](NC(=O)CCc1ccc(-c2ccc(CCCC/N=C(\N)NC(=O)c3nc(Cl)c(N)nc3N)cc2)cc1)C(N)=O |
| InChI | InChI=1S/C31H41ClN10O3/c32-26-28(35)41-27(34)25(40-26)30(45)42-31(37)38-18-4-2-5-19-7-12-21(13-8-19)22-14-9-20(10-15-22)11-16-24(43)39-23(29(36)44)6-1-3-17-33/h7-10,12-15,23H,1-6,11,16-18,33H2,(H2,36,44)(H,39,43)(H4,34,35,41)(H3,37,38,42,45)/t23-/m1/s1 |
| InChIKey | HEBVFOFTRBXGHP-HSZRJFAPSA-N |
| XLogP | 2.06 |
| TPSA | 243.51 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.19 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|