C27H34ClN9O2 — CID 169109808
3,5-diamino-N-[N'-[4-[4-[4-[3-(2-aminoethylamino)-3-oxopropyl]phenyl]phenyl]butyl]carbamimidoyl]-6-chloropyrazine-2-carboxamide (PubChem CID 169109808) has the molecular formula C27H34ClN9O2 and a molecular weight of 552.08 g/mol. Its IUPAC name is 3,5-diamino-N-[N'-[4-[4-[4-[3-(2-aminoethylamino)-3-oxopropyl]phenyl]phenyl]butyl]carbamimidoyl]-6-chloropyrazine-2-carboxamide.
| Compound Name | 3,5-diamino-N-[N'-[4-[4-[4-[3-(2-aminoethylamino)-3-oxopropyl]phenyl]phenyl]butyl]carbamimidoyl]-6-chloropyrazine-2-carboxamide |
|---|---|
| PubChem CID | 169109808 |
| Molecular Formula | C27H34ClN9O2 |
| Molecular Weight | 552.08 g/mol |
| Exact Mass | 551.25 |
| IUPAC Name | 3,5-diamino-N-[N'-[4-[4-[4-[3-(2-aminoethylamino)-3-oxopropyl]phenyl]phenyl]butyl]carbamimidoyl]-6-chloropyrazine-2-carboxamide |
| SMILES | NCCNC(=O)CCc1ccc(-c2ccc(CCCC/N=C(\N)NC(=O)c3nc(Cl)c(N)nc3N)cc2)cc1 |
| InChI | InChI=1S/C27H34ClN9O2/c28-23-25(31)36-24(30)22(35-23)26(39)37-27(32)34-15-2-1-3-17-4-9-19(10-5-17)20-11-6-18(7-12-20)8-13-21(38)33-16-14-29/h4-7,9-12H,1-3,8,13-16,29H2,(H,33,38)(H4,30,31,36)(H3,32,34,37,39) |
| InChIKey | BATNNDBYJLPVOZ-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 200.42 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.08 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|