C34H45ClN10O4 — CID 169109827
methyl (2R)-1-[3-[4-[4-[4-[[amino-[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]methylidene]amino]butyl]phenyl]phenyl]propanoyl]-4-(3-aminopropyl)piperazine-2-carboxylate (PubChem CID 169109827) has the molecular formula C34H45ClN10O4 and a molecular weight of 693.25 g/mol. Its IUPAC name is methyl (2R)-1-[3-[4-[4-[4-[[amino-[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]methylidene]amino]butyl]phenyl]phenyl]propanoyl]-4-(3-aminopropyl)piperazine-2-carboxylate.
| Compound Name | methyl (2R)-1-[3-[4-[4-[4-[[amino-[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]methylidene]amino]butyl]phenyl]phenyl]propanoyl]-4-(3-aminopropyl)piperazine-2-carboxylate |
|---|---|
| PubChem CID | 169109827 |
| Molecular Formula | C34H45ClN10O4 |
| Molecular Weight | 693.25 g/mol |
| Exact Mass | 692.33 |
| IUPAC Name | methyl (2R)-1-[3-[4-[4-[4-[[amino-[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]methylidene]amino]butyl]phenyl]phenyl]propanoyl]-4-(3-aminopropyl)piperazine-2-carboxylate |
| SMILES | COC(=O)[C@H]1CN(CCCN)CCN1C(=O)CCc1ccc(-c2ccc(CCCC/N=C(\N)NC(=O)c3nc(Cl)c(N)nc3N)cc2)cc1 |
| InChI | InChI=1S/C34H45ClN10O4/c1-49-33(48)26-21-44(18-4-16-36)19-20-45(26)27(46)15-10-23-8-13-25(14-9-23)24-11-6-22(7-12-24)5-2-3-17-40-34(39)43-32(47)28-30(37)42-31(38)29(35)41-28/h6-9,11-14,26H,2-5,10,15-21,36H2,1H3,(H4,37,38,42)(H3,39,40,43,47)/t26-/m1/s1 |
| InChIKey | QBCGUWUGKBKJJC-AREMUKBSSA-N |
| XLogP | 2.00 |
| TPSA | 221.17 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 693.25 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|