C32H43ClN10O3 — CID 169109973
3,5-diamino-6-chloro-N-[N'-[4-[4-[4-[3-[[(2S)-1,6-diamino-1-oxohexan-2-yl]-methylamino]-3-oxopropyl]phenyl]phenyl]butyl]carbamimidoyl]pyrazine-2-carboxamide (PubChem CID 169109973) has the molecular formula C32H43ClN10O3 and a molecular weight of 651.22 g/mol. Its IUPAC name is 3,5-diamino-6-chloro-N-[N'-[4-[4-[4-[3-[[(2S)-1,6-diamino-1-oxohexan-2-yl]-methylamino]-3-oxopropyl]phenyl]phenyl]butyl]carbamimidoyl]pyrazine-2-carboxamide.
| Compound Name | 3,5-diamino-6-chloro-N-[N'-[4-[4-[4-[3-[[(2S)-1,6-diamino-1-oxohexan-2-yl]-methylamino]-3-oxopropyl]phenyl]phenyl]butyl]carbamimidoyl]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 169109973 |
| Molecular Formula | C32H43ClN10O3 |
| Molecular Weight | 651.22 g/mol |
| Exact Mass | 650.32 |
| IUPAC Name | 3,5-diamino-6-chloro-N-[N'-[4-[4-[4-[3-[[(2S)-1,6-diamino-1-oxohexan-2-yl]-methylamino]-3-oxopropyl]phenyl]phenyl]butyl]carbamimidoyl]pyrazine-2-carboxamide |
| SMILES | CN(C(=O)CCc1ccc(-c2ccc(CCCC/N=C(\N)NC(=O)c3nc(Cl)c(N)nc3N)cc2)cc1)[C@@H](CCCCN)C(N)=O |
| InChI | InChI=1S/C32H43ClN10O3/c1-43(24(30(37)45)7-2-4-18-34)25(44)17-12-21-10-15-23(16-11-21)22-13-8-20(9-14-22)6-3-5-19-39-32(38)42-31(46)26-28(35)41-29(36)27(33)40-26/h8-11,13-16,24H,2-7,12,17-19,34H2,1H3,(H2,37,45)(H4,35,36,41)(H3,38,39,42,46)/t24-/m0/s1 |
| InChIKey | BUFWDRACWMQBLH-DEOSSOPVSA-N |
| XLogP | 2.40 |
| TPSA | 234.72 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.22 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|