C14H32N2O5 — CID 169110139
(5R)-6-[2-aminoethyl(5,6-dihydroxyhexyl)amino]hexane-1,2,5-triol (PubChem CID 169110139) has the molecular formula C14H32N2O5 and a molecular weight of 308.42 g/mol. Its IUPAC name is (5R)-6-[2-aminoethyl(5,6-dihydroxyhexyl)amino]hexane-1,2,5-triol.
| Compound Name | (5R)-6-[2-aminoethyl(5,6-dihydroxyhexyl)amino]hexane-1,2,5-triol |
|---|---|
| PubChem CID | 169110139 |
| Molecular Formula | C14H32N2O5 |
| Molecular Weight | 308.42 g/mol |
| Exact Mass | 308.23 |
| IUPAC Name | (5R)-6-[2-aminoethyl(5,6-dihydroxyhexyl)amino]hexane-1,2,5-triol |
| SMILES | NCCN(CCCCC(O)CO)C[C@H](O)CCC(O)CO |
| InChI | InChI=1S/C14H32N2O5/c15-6-8-16(7-2-1-3-13(20)10-17)9-12(19)4-5-14(21)11-18/h12-14,17-21H,1-11,15H2/t12-,13?,14?/m1/s1 |
| InChIKey | XFFBJTOVIHGLLD-IYXRBSQSSA-N |
| XLogP | -1.74 |
| TPSA | 130.41 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.42 |
| LogP ≤ 5 | -1.74 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|