About 6-[(1E)-1-fluorobuta-1,3-dienyl]-3,5-dimethyl-1H-pyridin-2-one
6-[(1E)-1-fluorobuta-1,3-dienyl]-3,5-dimethyl-1H-pyridin-2-one (PubChem CID 169110692) has the molecular formula C11H12FNO
and a molecular weight of 193.22 g/mol. Its IUPAC name is 6-[(1E)-1-fluorobuta-1,3-dienyl]-3,5-dimethyl-1H-pyridin-2-one.
Molecular Properties
| Compound Name | 6-[(1E)-1-fluorobuta-1,3-dienyl]-3,5-dimethyl-1H-pyridin-2-one |
| PubChem CID | 169110692 |
| Molecular Formula | C11H12FNO |
| Molecular Weight | 193.22 g/mol |
| Exact Mass | 193.09 |
| IUPAC Name | 6-[(1E)-1-fluorobuta-1,3-dienyl]-3,5-dimethyl-1H-pyridin-2-one |
| SMILES | C=C/C=C(/F)c1[nH]c(=O)c(C)cc1C |
| InChI | InChI=1S/C11H12FNO/c1-4-5-9(12)10-7(2)6-8(3)11(14)13-10/h4-6H,1H2,2-3H3,(H,13,14)/b9-5+ |
| InChIKey | CIGTVIPPDRCAPS-WEVVVXLNSA-N |
| XLogP | 2.49 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.22 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 6-[(1E)-1-fluorobuta-1,3-dienyl]-3,5-dimethyl-1H-pyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[(1E)-1-fluorobuta-1,3-dienyl]-3,5-dimethyl-1H-pyridin-2-one?
The IUPAC name of 6-[(1E)-1-fluorobuta-1,3-dienyl]-3,5-dimethyl-1H-pyridin-2-one (CID 169110692) is 6-[(1E)-1-fluorobuta-1,3-dienyl]-3,5-dimethyl-1H-pyridin-2-one.
What is the SMILES notation for 6-[(1E)-1-fluorobuta-1,3-dienyl]-3,5-dimethyl-1H-pyridin-2-one?
The canonical SMILES for 6-[(1E)-1-fluorobuta-1,3-dienyl]-3,5-dimethyl-1H-pyridin-2-one is C=C/C=C(/F)c1[nH]c(=O)c(C)cc1C.
What is the InChIKey of 6-[(1E)-1-fluorobuta-1,3-dienyl]-3,5-dimethyl-1H-pyridin-2-one?
The InChIKey is CIGTVIPPDRCAPS-WEVVVXLNSA-N. The full InChI is InChI=1S/C11H12FNO/c1-4-5-9(12)10-7(2)6-8(3)11(14)13-10/h4-6H,1H2,2-3H3,(H,13,14)/b9-5+.
What are the key properties of 6-[(1E)-1-fluorobuta-1,3-dienyl]-3,5-dimethyl-1H-pyridin-2-one?
6-[(1E)-1-fluorobuta-1,3-dienyl]-3,5-dimethyl-1H-pyridin-2-one has a molecular weight of 193.22 g/mol, XLogP of 2.49, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[(1E)-1-fluorobuta-1,3-dienyl]-3,5-dimethyl-1H-pyridin-2-one is sourced from PubChem (CID 169110692), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).