C25H30N6O3 — CID 169110949
N-[4-amino-1-(oxan-2-yl)pyrazolo[4,5-c]pyridin-7-yl]-N'-(cyclopropylmethyl)-N'-[(2-methylphenyl)methyl]oxamide (PubChem CID 169110949) has the molecular formula C25H30N6O3 and a molecular weight of 462.55 g/mol. Its IUPAC name is N-[4-amino-1-(oxan-2-yl)pyrazolo[4,5-c]pyridin-7-yl]-N'-(cyclopropylmethyl)-N'-[(2-methylphenyl)methyl]oxamide.
| Compound Name | N-[4-amino-1-(oxan-2-yl)pyrazolo[4,5-c]pyridin-7-yl]-N'-(cyclopropylmethyl)-N'-[(2-methylphenyl)methyl]oxamide |
|---|---|
| PubChem CID | 169110949 |
| Molecular Formula | C25H30N6O3 |
| Molecular Weight | 462.55 g/mol |
| Exact Mass | 462.24 |
| IUPAC Name | N-[4-amino-1-(oxan-2-yl)pyrazolo[4,5-c]pyridin-7-yl]-N'-(cyclopropylmethyl)-N'-[(2-methylphenyl)methyl]oxamide |
| SMILES | Cc1ccccc1CN(CC1CC1)C(=O)C(=O)Nc1cnc(N)c2cnn(C3CCCCO3)c12 |
| InChI | InChI=1S/C25H30N6O3/c1-16-6-2-3-7-18(16)15-30(14-17-9-10-17)25(33)24(32)29-20-13-27-23(26)19-12-28-31(22(19)20)21-8-4-5-11-34-21/h2-3,6-7,12-13,17,21H,4-5,8-11,14-15H2,1H3,(H2,26,27)(H,29,32) |
| InChIKey | LTUDEKWUYPGJDV-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 115.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.55 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|