C9H4F6O — CID 169111091
2-fluoro-4-(1,1,2,2,2-pentafluoroethyl)benzaldehyde (PubChem CID 169111091) has the molecular formula C9H4F6O and a molecular weight of 242.12 g/mol. Its IUPAC name is 2-fluoro-4-(1,1,2,2,2-pentafluoroethyl)benzaldehyde.
| Compound Name | 2-fluoro-4-(1,1,2,2,2-pentafluoroethyl)benzaldehyde |
|---|---|
| PubChem CID | 169111091 |
| Molecular Formula | C9H4F6O |
| Molecular Weight | 242.12 g/mol |
| Exact Mass | 242.02 |
| IUPAC Name | 2-fluoro-4-(1,1,2,2,2-pentafluoroethyl)benzaldehyde |
| SMILES | O=Cc1ccc(C(F)(F)C(F)(F)F)cc1F |
| InChI | InChI=1S/C9H4F6O/c10-7-3-6(2-1-5(7)4-16)8(11,12)9(13,14)15/h1-4H |
| InChIKey | ZGQMUKZMQAKWTG-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.12 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|