C11H10F6 — CID 169111339
2-fluoro-4-(1,1,2,2,2-pentafluoroethyl)-1-propan-2-ylbenzene (PubChem CID 169111339) has the molecular formula C11H10F6 and a molecular weight of 256.19 g/mol. Its IUPAC name is 2-fluoro-4-(1,1,2,2,2-pentafluoroethyl)-1-propan-2-ylbenzene.
| Compound Name | 2-fluoro-4-(1,1,2,2,2-pentafluoroethyl)-1-propan-2-ylbenzene |
|---|---|
| PubChem CID | 169111339 |
| Molecular Formula | C11H10F6 |
| Molecular Weight | 256.19 g/mol |
| Exact Mass | 256.07 |
| IUPAC Name | 2-fluoro-4-(1,1,2,2,2-pentafluoroethyl)-1-propan-2-ylbenzene |
| SMILES | CC(C)c1ccc(C(F)(F)C(F)(F)F)cc1F |
| InChI | InChI=1S/C11H10F6/c1-6(2)8-4-3-7(5-9(8)12)10(13,14)11(15,16)17/h3-6H,1-2H3 |
| InChIKey | PNZOIFWBZHAXOP-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.19 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|