About N'-(2-methoxyethyl)-N'-[[5-(trifluoromethyl)-2-pyridinyl]methyl]oxamide
N'-(2-methoxyethyl)-N'-[[5-(trifluoromethyl)-2-pyridinyl]methyl]oxamide (PubChem CID 169111998) has the molecular formula C12H14F3N3O3
and a molecular weight of 305.26 g/mol. Its IUPAC name is N'-(2-methoxyethyl)-N'-[[5-(trifluoromethyl)-2-pyridinyl]methyl]oxamide.
Molecular Properties
| Compound Name | N'-(2-methoxyethyl)-N'-[[5-(trifluoromethyl)-2-pyridinyl]methyl]oxamide |
| PubChem CID | 169111998 |
| Molecular Formula | C12H14F3N3O3 |
| Molecular Weight | 305.26 g/mol |
| Exact Mass | 305.10 |
| IUPAC Name | N'-(2-methoxyethyl)-N'-[[5-(trifluoromethyl)-2-pyridinyl]methyl]oxamide |
| SMILES | COCCN(Cc1ccc(C(F)(F)F)cn1)C(=O)C(N)=O |
| InChI | InChI=1S/C12H14F3N3O3/c1-21-5-4-18(11(20)10(16)19)7-9-3-2-8(6-17-9)12(13,14)15/h2-3,6H,4-5,7H2,1H3,(H2,16,19) |
| InChIKey | DXTNUIOYXPVZBD-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 85.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 305.26 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze N'-(2-methoxyethyl)-N'-[[5-(trifluoromethyl)-2-pyridinyl]methyl]oxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-(2-methoxyethyl)-N'-[[5-(trifluoromethyl)-2-pyridinyl]methyl]oxamide?
The IUPAC name of N'-(2-methoxyethyl)-N'-[[5-(trifluoromethyl)-2-pyridinyl]methyl]oxamide (CID 169111998) is N'-(2-methoxyethyl)-N'-[[5-(trifluoromethyl)-2-pyridinyl]methyl]oxamide.
What is the SMILES notation for N'-(2-methoxyethyl)-N'-[[5-(trifluoromethyl)-2-pyridinyl]methyl]oxamide?
The canonical SMILES for N'-(2-methoxyethyl)-N'-[[5-(trifluoromethyl)-2-pyridinyl]methyl]oxamide is COCCN(Cc1ccc(C(F)(F)F)cn1)C(=O)C(N)=O.
What is the InChIKey of N'-(2-methoxyethyl)-N'-[[5-(trifluoromethyl)-2-pyridinyl]methyl]oxamide?
The InChIKey is DXTNUIOYXPVZBD-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14F3N3O3/c1-21-5-4-18(11(20)10(16)19)7-9-3-2-8(6-17-9)12(13,14)15/h2-3,6H,4-5,7H2,1H3,(H2,16,19).
What are the key properties of N'-(2-methoxyethyl)-N'-[[5-(trifluoromethyl)-2-pyridinyl]methyl]oxamide?
N'-(2-methoxyethyl)-N'-[[5-(trifluoromethyl)-2-pyridinyl]methyl]oxamide has a molecular weight of 305.26 g/mol, XLogP of 0.56, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N'-(2-methoxyethyl)-N'-[[5-(trifluoromethyl)-2-pyridinyl]methyl]oxamide is sourced from PubChem (CID 169111998), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).