C26H34N8O3Si — CID 169112124
N-[4-amino-1-(2-trimethylsilylethoxymethyl)pyrazolo[4,5-c]pyridin-7-yl]-N'-benzyl-N'-[(2-methylpyrazol-3-yl)methyl]oxamide (PubChem CID 169112124) has the molecular formula C26H34N8O3Si and a molecular weight of 534.70 g/mol. Its IUPAC name is N-[4-amino-1-(2-trimethylsilylethoxymethyl)pyrazolo[4,5-c]pyridin-7-yl]-N'-benzyl-N'-[(2-methylpyrazol-3-yl)methyl]oxamide.
| Compound Name | N-[4-amino-1-(2-trimethylsilylethoxymethyl)pyrazolo[4,5-c]pyridin-7-yl]-N'-benzyl-N'-[(2-methylpyrazol-3-yl)methyl]oxamide |
|---|---|
| PubChem CID | 169112124 |
| Molecular Formula | C26H34N8O3Si |
| Molecular Weight | 534.70 g/mol |
| Exact Mass | 534.25 |
| IUPAC Name | N-[4-amino-1-(2-trimethylsilylethoxymethyl)pyrazolo[4,5-c]pyridin-7-yl]-N'-benzyl-N'-[(2-methylpyrazol-3-yl)methyl]oxamide |
| SMILES | Cn1nccc1CN(Cc1ccccc1)C(=O)C(=O)Nc1cnc(N)c2cnn(COCC[Si](C)(C)C)c12 |
| InChI | InChI=1S/C26H34N8O3Si/c1-32-20(10-11-29-32)17-33(16-19-8-6-5-7-9-19)26(36)25(35)31-22-15-28-24(27)21-14-30-34(23(21)22)18-37-12-13-38(2,3)4/h5-11,14-15H,12-13,16-18H2,1-4H3,(H2,27,28)(H,31,35) |
| InChIKey | UAAGVCNDHFXPRR-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 133.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.70 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|