C31H40N6O3S — CID 169112249
N-[6-amino-5-(oxetan-3-yl)-3-pyridinyl]-2-[(2R,5S)-5-methyl-2-[2-(1,2,2-trimethylpiperidin-4-yl)-1,3-benzothiazol-5-yl]piperidin-1-yl]-2-oxoacetamide (PubChem CID 169112249) has the molecular formula C31H40N6O3S and a molecular weight of 576.77 g/mol. Its IUPAC name is N-[6-amino-5-(oxetan-3-yl)-3-pyridinyl]-2-[(2R,5S)-5-methyl-2-[2-(1,2,2-trimethylpiperidin-4-yl)-1,3-benzothiazol-5-yl]piperidin-1-yl]-2-oxoacetamide.
| Compound Name | N-[6-amino-5-(oxetan-3-yl)-3-pyridinyl]-2-[(2R,5S)-5-methyl-2-[2-(1,2,2-trimethylpiperidin-4-yl)-1,3-benzothiazol-5-yl]piperidin-1-yl]-2-oxoacetamide |
|---|---|
| PubChem CID | 169112249 |
| Molecular Formula | C31H40N6O3S |
| Molecular Weight | 576.77 g/mol |
| Exact Mass | 576.29 |
| IUPAC Name | N-[6-amino-5-(oxetan-3-yl)-3-pyridinyl]-2-[(2R,5S)-5-methyl-2-[2-(1,2,2-trimethylpiperidin-4-yl)-1,3-benzothiazol-5-yl]piperidin-1-yl]-2-oxoacetamide |
| SMILES | C[C@H]1CC[C@H](c2ccc3sc(C4CCN(C)C(C)(C)C4)nc3c2)N(C(=O)C(=O)Nc2cnc(N)c(C3COC3)c2)C1 |
| InChI | InChI=1S/C31H40N6O3S/c1-18-5-7-25(19-6-8-26-24(11-19)35-29(41-26)20-9-10-36(4)31(2,3)13-20)37(15-18)30(39)28(38)34-22-12-23(21-16-40-17-21)27(32)33-14-22/h6,8,11-12,14,18,20-21,25H,5,7,9-10,13,15-17H2,1-4H3,(H2,32,33)(H,34,38)/t18-,20?,25+/m0/s1 |
| InChIKey | ILOODEKVUNATLM-COAOWADVSA-N |
| XLogP | 4.91 |
| TPSA | 113.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.77 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|