C19H29BN2O2S — CID 169112910
N,N,2-trimethyl-1-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-benzothiazol-2-yl]propan-2-amine (PubChem CID 169112910) has the molecular formula C19H29BN2O2S and a molecular weight of 360.33 g/mol. Its IUPAC name is N,N,2-trimethyl-1-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-benzothiazol-2-yl]propan-2-amine.
| Compound Name | N,N,2-trimethyl-1-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-benzothiazol-2-yl]propan-2-amine |
|---|---|
| PubChem CID | 169112910 |
| Molecular Formula | C19H29BN2O2S |
| Molecular Weight | 360.33 g/mol |
| Exact Mass | 360.20 |
| IUPAC Name | N,N,2-trimethyl-1-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-benzothiazol-2-yl]propan-2-amine |
| SMILES | CN(C)C(C)(C)Cc1nc2cc(B3OC(C)(C)C(C)(C)O3)ccc2s1 |
| InChI | InChI=1S/C19H29BN2O2S/c1-17(2,22(7)8)12-16-21-14-11-13(9-10-15(14)25-16)20-23-18(3,4)19(5,6)24-20/h9-11H,12H2,1-8H3 |
| InChIKey | HOQFRLNVSQUEAQ-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 34.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.33 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|