C15H22F3NO4 — CID 169113047
2,2,2-trifluoroethyl 2-[(2R,5S)-5-methyl-2-(oxan-3-yl)piperidin-1-yl]-2-oxoacetate (PubChem CID 169113047) has the molecular formula C15H22F3NO4 and a molecular weight of 337.34 g/mol. Its IUPAC name is 2,2,2-trifluoroethyl 2-[(2R,5S)-5-methyl-2-(oxan-3-yl)piperidin-1-yl]-2-oxoacetate.
| Compound Name | 2,2,2-trifluoroethyl 2-[(2R,5S)-5-methyl-2-(oxan-3-yl)piperidin-1-yl]-2-oxoacetate |
|---|---|
| PubChem CID | 169113047 |
| Molecular Formula | C15H22F3NO4 |
| Molecular Weight | 337.34 g/mol |
| Exact Mass | 337.15 |
| IUPAC Name | 2,2,2-trifluoroethyl 2-[(2R,5S)-5-methyl-2-(oxan-3-yl)piperidin-1-yl]-2-oxoacetate |
| SMILES | C[C@H]1CC[C@H](C2CCCOC2)N(C(=O)C(=O)OCC(F)(F)F)C1 |
| InChI | InChI=1S/C15H22F3NO4/c1-10-4-5-12(11-3-2-6-22-8-11)19(7-10)13(20)14(21)23-9-15(16,17)18/h10-12H,2-9H2,1H3/t10-,11?,12+/m0/s1 |
| InChIKey | RCRWUQQFJMZQDA-ASKATJPDSA-N |
| XLogP | 2.15 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.34 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|