C13H20F3NO3 — CID 169113118
2,2,2-trifluoroethyl 2-[(2S,5R)-5-methyl-2-propan-2-ylpiperidin-1-yl]-2-oxoacetate (PubChem CID 169113118) has the molecular formula C13H20F3NO3 and a molecular weight of 295.30 g/mol. Its IUPAC name is 2,2,2-trifluoroethyl 2-[(2S,5R)-5-methyl-2-propan-2-ylpiperidin-1-yl]-2-oxoacetate.
| Compound Name | 2,2,2-trifluoroethyl 2-[(2S,5R)-5-methyl-2-propan-2-ylpiperidin-1-yl]-2-oxoacetate |
|---|---|
| PubChem CID | 169113118 |
| Molecular Formula | C13H20F3NO3 |
| Molecular Weight | 295.30 g/mol |
| Exact Mass | 295.14 |
| IUPAC Name | 2,2,2-trifluoroethyl 2-[(2S,5R)-5-methyl-2-propan-2-ylpiperidin-1-yl]-2-oxoacetate |
| SMILES | CC(C)[C@@H]1CC[C@@H](C)CN1C(=O)C(=O)OCC(F)(F)F |
| InChI | InChI=1S/C13H20F3NO3/c1-8(2)10-5-4-9(3)6-17(10)11(18)12(19)20-7-13(14,15)16/h8-10H,4-7H2,1-3H3/t9-,10+/m1/s1 |
| InChIKey | PJSMFGOKJCTHJK-ZJUUUORDSA-N |
| XLogP | 2.38 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.30 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|