C16H20N2O3 — CID 169113499
2-[(2R,5S)-2-(2,3-dihydro-1-benzofuran-7-yl)-5-methylpiperidin-1-yl]-2-oxoacetamide (PubChem CID 169113499) has the molecular formula C16H20N2O3 and a molecular weight of 288.35 g/mol. Its IUPAC name is 2-[(2R,5S)-2-(2,3-dihydro-1-benzofuran-7-yl)-5-methylpiperidin-1-yl]-2-oxoacetamide.
| Compound Name | 2-[(2R,5S)-2-(2,3-dihydro-1-benzofuran-7-yl)-5-methylpiperidin-1-yl]-2-oxoacetamide |
|---|---|
| PubChem CID | 169113499 |
| Molecular Formula | C16H20N2O3 |
| Molecular Weight | 288.35 g/mol |
| Exact Mass | 288.15 |
| IUPAC Name | 2-[(2R,5S)-2-(2,3-dihydro-1-benzofuran-7-yl)-5-methylpiperidin-1-yl]-2-oxoacetamide |
| SMILES | C[C@H]1CC[C@H](c2cccc3c2OCC3)N(C(=O)C(N)=O)C1 |
| InChI | InChI=1S/C16H20N2O3/c1-10-5-6-13(18(9-10)16(20)15(17)19)12-4-2-3-11-7-8-21-14(11)12/h2-4,10,13H,5-9H2,1H3,(H2,17,19)/t10-,13+/m0/s1 |
| InChIKey | OOFTUZLBPKXRHM-GXFFZTMASA-N |
| XLogP | 1.41 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.35 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|