About (2R,5S)-2-(3,6-dihydro-2H-pyran-4-yl)-5-methylpiperidine
(2R,5S)-2-(3,6-dihydro-2H-pyran-4-yl)-5-methylpiperidine (PubChem CID 169113536) has the molecular formula C11H19NO
and a molecular weight of 181.28 g/mol. Its IUPAC name is (2R,5S)-2-(3,6-dihydro-2H-pyran-4-yl)-5-methylpiperidine.
Molecular Properties
| Compound Name | (2R,5S)-2-(3,6-dihydro-2H-pyran-4-yl)-5-methylpiperidine |
| PubChem CID | 169113536 |
| Molecular Formula | C11H19NO |
| Molecular Weight | 181.28 g/mol |
| Exact Mass | 181.15 |
| IUPAC Name | (2R,5S)-2-(3,6-dihydro-2H-pyran-4-yl)-5-methylpiperidine |
| SMILES | C[C@H]1CC[C@H](C2=CCOCC2)NC1 |
| InChI | InChI=1S/C11H19NO/c1-9-2-3-11(12-8-9)10-4-6-13-7-5-10/h4,9,11-12H,2-3,5-8H2,1H3/t9-,11+/m0/s1 |
| InChIKey | FJIVBHGBNCQWEV-GXSJLCMTSA-N |
| XLogP | 1.72 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.28 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (2R,5S)-2-(3,6-dihydro-2H-pyran-4-yl)-5-methylpiperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R,5S)-2-(3,6-dihydro-2H-pyran-4-yl)-5-methylpiperidine?
The IUPAC name of (2R,5S)-2-(3,6-dihydro-2H-pyran-4-yl)-5-methylpiperidine (CID 169113536) is (2R,5S)-2-(3,6-dihydro-2H-pyran-4-yl)-5-methylpiperidine.
What is the SMILES notation for (2R,5S)-2-(3,6-dihydro-2H-pyran-4-yl)-5-methylpiperidine?
The canonical SMILES for (2R,5S)-2-(3,6-dihydro-2H-pyran-4-yl)-5-methylpiperidine is C[C@H]1CC[C@H](C2=CCOCC2)NC1.
What is the InChIKey of (2R,5S)-2-(3,6-dihydro-2H-pyran-4-yl)-5-methylpiperidine?
The InChIKey is FJIVBHGBNCQWEV-GXSJLCMTSA-N. The full InChI is InChI=1S/C11H19NO/c1-9-2-3-11(12-8-9)10-4-6-13-7-5-10/h4,9,11-12H,2-3,5-8H2,1H3/t9-,11+/m0/s1.
What are the key properties of (2R,5S)-2-(3,6-dihydro-2H-pyran-4-yl)-5-methylpiperidine?
(2R,5S)-2-(3,6-dihydro-2H-pyran-4-yl)-5-methylpiperidine has a molecular weight of 181.28 g/mol, XLogP of 1.72, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2R,5S)-2-(3,6-dihydro-2H-pyran-4-yl)-5-methylpiperidine is sourced from PubChem (CID 169113536), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).