C27H36F3N3O3S — CID 169113552
2,2,2-trifluoroethyl 2-[(2R,5S)-5-methyl-2-[2-(1,2,2,6,6-pentamethylpiperidin-4-yl)-1,3-benzothiazol-5-yl]piperidin-1-yl]-2-oxoacetate (PubChem CID 169113552) has the molecular formula C27H36F3N3O3S and a molecular weight of 539.66 g/mol. Its IUPAC name is 2,2,2-trifluoroethyl 2-[(2R,5S)-5-methyl-2-[2-(1,2,2,6,6-pentamethylpiperidin-4-yl)-1,3-benzothiazol-5-yl]piperidin-1-yl]-2-oxoacetate.
| Compound Name | 2,2,2-trifluoroethyl 2-[(2R,5S)-5-methyl-2-[2-(1,2,2,6,6-pentamethylpiperidin-4-yl)-1,3-benzothiazol-5-yl]piperidin-1-yl]-2-oxoacetate |
|---|---|
| PubChem CID | 169113552 |
| Molecular Formula | C27H36F3N3O3S |
| Molecular Weight | 539.66 g/mol |
| Exact Mass | 539.24 |
| IUPAC Name | 2,2,2-trifluoroethyl 2-[(2R,5S)-5-methyl-2-[2-(1,2,2,6,6-pentamethylpiperidin-4-yl)-1,3-benzothiazol-5-yl]piperidin-1-yl]-2-oxoacetate |
| SMILES | C[C@H]1CC[C@H](c2ccc3sc(C4CC(C)(C)N(C)C(C)(C)C4)nc3c2)N(C(=O)C(=O)OCC(F)(F)F)C1 |
| InChI | InChI=1S/C27H36F3N3O3S/c1-16-7-9-20(33(14-16)23(34)24(35)36-15-27(28,29)30)17-8-10-21-19(11-17)31-22(37-21)18-12-25(2,3)32(6)26(4,5)13-18/h8,10-11,16,18,20H,7,9,12-15H2,1-6H3/t16-,20+/m0/s1 |
| InChIKey | AZKOOOAIBXLEQX-OXJNMPFZSA-N |
| XLogP | 6.07 |
| TPSA | 62.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.66 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|