C14H18F3N3O3 — CID 169113755
2,2,2-trifluoroethyl 2-[(2S,5R)-5-methyl-2-(2-methylpyrazol-3-yl)piperidin-1-yl]-2-oxoacetate (PubChem CID 169113755) has the molecular formula C14H18F3N3O3 and a molecular weight of 333.31 g/mol. Its IUPAC name is 2,2,2-trifluoroethyl 2-[(2S,5R)-5-methyl-2-(2-methylpyrazol-3-yl)piperidin-1-yl]-2-oxoacetate.
| Compound Name | 2,2,2-trifluoroethyl 2-[(2S,5R)-5-methyl-2-(2-methylpyrazol-3-yl)piperidin-1-yl]-2-oxoacetate |
|---|---|
| PubChem CID | 169113755 |
| Molecular Formula | C14H18F3N3O3 |
| Molecular Weight | 333.31 g/mol |
| Exact Mass | 333.13 |
| IUPAC Name | 2,2,2-trifluoroethyl 2-[(2S,5R)-5-methyl-2-(2-methylpyrazol-3-yl)piperidin-1-yl]-2-oxoacetate |
| SMILES | C[C@@H]1CC[C@@H](c2ccnn2C)N(C(=O)C(=O)OCC(F)(F)F)C1 |
| InChI | InChI=1S/C14H18F3N3O3/c1-9-3-4-11(10-5-6-18-19(10)2)20(7-9)12(21)13(22)23-8-14(15,16)17/h5-6,9,11H,3-4,7-8H2,1-2H3/t9-,11+/m1/s1 |
| InChIKey | YZRPJGAMZIFZAR-KOLCDFICSA-N |
| XLogP | 1.83 |
| TPSA | 64.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.31 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|